C40H28 — CID 161193415
2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene (PubChem CID 161193415) has the molecular formula C40H28 and a molecular weight of 508.66 g/mol. Its IUPAC name is 2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene.
| Compound Name | 2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene |
|---|---|
| PubChem CID | 161193415 |
| Molecular Formula | C40H28 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene |
| SMILES | CC#Cc1c2ccccc2c(C#CC)c2ccccc12.CC#Cc1ccc2cc3cc(C#CC)ccc3cc2c1 |
| InChI | InChI=1S/2C20H14/c1-3-9-15-17-11-5-7-13-19(17)16(10-4-2)20-14-8-6-12-18(15)20;1-3-5-15-7-9-17-14-20-12-16(6-4-2)8-10-18(20)13-19(17)11-15/h5-8,11-14H,1-2H3;7-14H,1-2H3 |
| InChIKey | UUAGFJCGLSDXQW-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|