About 2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene
2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene (PubChem CID 161193415) has the molecular formula C40H28
and a molecular weight of 508.66 g/mol. Its IUPAC name is 2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene.
Molecular Properties
| Compound Name | 2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene |
| PubChem CID | 161193415 |
| Molecular Formula | C40H28 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | 2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene |
| SMILES | CC#Cc1c2ccccc2c(C#CC)c2ccccc12.CC#Cc1ccc2cc3cc(C#CC)ccc3cc2c1 |
| InChI | InChI=1S/2C20H14/c1-3-9-15-17-11-5-7-13-19(17)16(10-4-2)20-14-8-6-12-18(15)20;1-3-5-15-7-9-17-14-20-12-16(6-4-2)8-10-18(20)13-19(17)11-15/h5-8,11-14H,1-2H3;7-14H,1-2H3 |
| InChIKey | UUAGFJCGLSDXQW-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene?
The IUPAC name of 2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene (CID 161193415) is 2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene.
What is the SMILES notation for 2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene?
The canonical SMILES for 2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene is CC#Cc1c2ccccc2c(C#CC)c2ccccc12.CC#Cc1ccc2cc3cc(C#CC)ccc3cc2c1.
What is the InChIKey of 2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene?
The InChIKey is UUAGFJCGLSDXQW-UHFFFAOYSA-N. The full InChI is InChI=1S/2C20H14/c1-3-9-15-17-11-5-7-13-19(17)16(10-4-2)20-14-8-6-12-18(15)20;1-3-5-15-7-9-17-14-20-12-16(6-4-2)8-10-18(20)13-19(17)11-15/h5-8,11-14H,1-2H3;7-14H,1-2H3.
What are the key properties of 2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene?
2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene has a molecular weight of 508.66 g/mol, XLogP of 9.47, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-bis(prop-1-ynyl)anthracene;9,10-bis(prop-1-ynyl)anthracene is sourced from PubChem (CID 161193415), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).