About 4-(2-chloropyrimidin-4-yl)morpholine;ethane;tungsten
4-(2-chloropyrimidin-4-yl)morpholine;ethane;tungsten (PubChem CID 161195387) has the molecular formula C10H16ClN3OW
and a molecular weight of 413.55 g/mol. Its IUPAC name is 4-(2-chloropyrimidin-4-yl)morpholine;ethane;tungsten.
Molecular Properties
| Compound Name | 4-(2-chloropyrimidin-4-yl)morpholine;ethane;tungsten |
| PubChem CID | 161195387 |
| Molecular Formula | C10H16ClN3OW |
| Molecular Weight | 413.55 g/mol |
| Exact Mass | 413.05 |
| IUPAC Name | 4-(2-chloropyrimidin-4-yl)morpholine;ethane;tungsten |
| SMILES | CC.Clc1nccc(N2CCOCC2)n1.[W] |
| InChI | InChI=1S/C8H10ClN3O.C2H6.W/c9-8-10-2-1-7(11-8)12-3-5-13-6-4-12;1-2;/h1-2H,3-6H2;1-2H3; |
| InChIKey | UUGSHLLPIABPRB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.55 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-chloropyrimidin-4-yl)morpholine;ethane;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloropyrimidin-4-yl)morpholine;ethane;tungsten?
The IUPAC name of 4-(2-chloropyrimidin-4-yl)morpholine;ethane;tungsten (CID 161195387) is 4-(2-chloropyrimidin-4-yl)morpholine;ethane;tungsten.
What is the SMILES notation for 4-(2-chloropyrimidin-4-yl)morpholine;ethane;tungsten?
The canonical SMILES for 4-(2-chloropyrimidin-4-yl)morpholine;ethane;tungsten is CC.Clc1nccc(N2CCOCC2)n1.[W].
What is the InChIKey of 4-(2-chloropyrimidin-4-yl)morpholine;ethane;tungsten?
The InChIKey is UUGSHLLPIABPRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClN3O.C2H6.W/c9-8-10-2-1-7(11-8)12-3-5-13-6-4-12;1-2;/h1-2H,3-6H2;1-2H3;.
What are the key properties of 4-(2-chloropyrimidin-4-yl)morpholine;ethane;tungsten?
4-(2-chloropyrimidin-4-yl)morpholine;ethane;tungsten has a molecular weight of 413.55 g/mol, XLogP of 1.99, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloropyrimidin-4-yl)morpholine;ethane;tungsten is sourced from PubChem (CID 161195387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).