C20H29ClN2OS2 — CID 161195757
N-(2-adamantyl)-6-chloro-2-ethylsulfanylpyridine-3-carboxamide;ethanethiol (PubChem CID 161195757) has the molecular formula C20H29ClN2OS2 and a molecular weight of 413.05 g/mol. Its IUPAC name is N-(2-adamantyl)-6-chloro-2-ethylsulfanylpyridine-3-carboxamide;ethanethiol.
| Compound Name | N-(2-adamantyl)-6-chloro-2-ethylsulfanylpyridine-3-carboxamide;ethanethiol |
|---|---|
| PubChem CID | 161195757 |
| Molecular Formula | C20H29ClN2OS2 |
| Molecular Weight | 413.05 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N-(2-adamantyl)-6-chloro-2-ethylsulfanylpyridine-3-carboxamide;ethanethiol |
| SMILES | CCS.CCSc1nc(Cl)ccc1C(=O)NC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H23ClN2OS.C2H6S/c1-2-23-18-14(3-4-15(19)20-18)17(22)21-16-12-6-10-5-11(8-12)9-13(16)7-10;1-2-3/h3-4,10-13,16H,2,5-9H2,1H3,(H,21,22);3H,2H2,1H3 |
| InChIKey | UUHXOBBZQGJBLR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.05 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|