C15H33O9P — CID 161196889
methoxy-[3-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propyl]phosphinic acid (PubChem CID 161196889) has the molecular formula C15H33O9P and a molecular weight of 388.39 g/mol. Its IUPAC name is methoxy-[3-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propyl]phosphinic acid.
| Compound Name | methoxy-[3-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propyl]phosphinic acid |
|---|---|
| PubChem CID | 161196889 |
| Molecular Formula | C15H33O9P |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | methoxy-[3-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]propyl]phosphinic acid |
| SMILES | COCCOCCOCCOCCOCCOCCCP(=O)(O)OC |
| InChI | InChI=1S/C15H33O9P/c1-18-5-6-21-9-10-23-13-14-24-12-11-22-8-7-20-4-3-15-25(16,17)19-2/h3-15H2,1-2H3,(H,16,17) |
| InChIKey | UULRIFMCSZQJIZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 101.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|