About 3,3-diethoxyprop-1-enylsilane;dimethoxymethyl(ethenyl)silane
3,3-diethoxyprop-1-enylsilane;dimethoxymethyl(ethenyl)silane (PubChem CID 161198336) has the molecular formula C12H28O4Si2
and a molecular weight of 292.52 g/mol. Its IUPAC name is 3,3-diethoxyprop-1-enylsilane;dimethoxymethyl(ethenyl)silane.
Molecular Properties
| Compound Name | 3,3-diethoxyprop-1-enylsilane;dimethoxymethyl(ethenyl)silane |
| PubChem CID | 161198336 |
| Molecular Formula | C12H28O4Si2 |
| Molecular Weight | 292.52 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 3,3-diethoxyprop-1-enylsilane;dimethoxymethyl(ethenyl)silane |
| SMILES | C=C[SiH2]C(OC)OC.CCOC(C=C[SiH3])OCC |
| InChI | InChI=1S/C7H16O2Si.C5H12O2Si/c1-3-8-7(5-6-10)9-4-2;1-4-8-5(6-2)7-3/h5-7H,3-4H2,1-2,10H3;4-5H,1,8H2,2-3H3 |
| InChIKey | UUQNZIFWXMNJBX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.52 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3,3-diethoxyprop-1-enylsilane;dimethoxymethyl(ethenyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-diethoxyprop-1-enylsilane;dimethoxymethyl(ethenyl)silane?
The IUPAC name of 3,3-diethoxyprop-1-enylsilane;dimethoxymethyl(ethenyl)silane (CID 161198336) is 3,3-diethoxyprop-1-enylsilane;dimethoxymethyl(ethenyl)silane.
What is the SMILES notation for 3,3-diethoxyprop-1-enylsilane;dimethoxymethyl(ethenyl)silane?
The canonical SMILES for 3,3-diethoxyprop-1-enylsilane;dimethoxymethyl(ethenyl)silane is C=C[SiH2]C(OC)OC.CCOC(C=C[SiH3])OCC.
What is the InChIKey of 3,3-diethoxyprop-1-enylsilane;dimethoxymethyl(ethenyl)silane?
The InChIKey is UUQNZIFWXMNJBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O2Si.C5H12O2Si/c1-3-8-7(5-6-10)9-4-2;1-4-8-5(6-2)7-3/h5-7H,3-4H2,1-2,10H3;4-5H,1,8H2,2-3H3.
What are the key properties of 3,3-diethoxyprop-1-enylsilane;dimethoxymethyl(ethenyl)silane?
3,3-diethoxyprop-1-enylsilane;dimethoxymethyl(ethenyl)silane has a molecular weight of 292.52 g/mol, XLogP of 0.14, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-diethoxyprop-1-enylsilane;dimethoxymethyl(ethenyl)silane is sourced from PubChem (CID 161198336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).