C26H52N2 — CID 161198486
(1R,3R,5R)-2-tert-butyl-3,5-dimethyl-2-azabicyclo[3.1.0]hexane;(1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexane;ethane (PubChem CID 161198486) has the molecular formula C26H52N2 and a molecular weight of 392.72 g/mol. Its IUPAC name is (1R,3R,5R)-2-tert-butyl-3,5-dimethyl-2-azabicyclo[3.1.0]hexane;(1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexane;ethane.
| Compound Name | (1R,3R,5R)-2-tert-butyl-3,5-dimethyl-2-azabicyclo[3.1.0]hexane;(1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexane;ethane |
|---|---|
| PubChem CID | 161198486 |
| Molecular Formula | C26H52N2 |
| Molecular Weight | 392.72 g/mol |
| Exact Mass | 392.41 |
| IUPAC Name | (1R,3R,5R)-2-tert-butyl-3,5-dimethyl-2-azabicyclo[3.1.0]hexane;(1R,5S)-2,3-ditert-butyl-3-azabicyclo[3.1.0]hexane;ethane |
| SMILES | CC.CC(C)(C)C1[C@@H]2C[C@@H]2CN1C(C)(C)C.C[C@@H]1C[C@@]2(C)C[C@H]2N1C(C)(C)C |
| InChI | InChI=1S/C13H25N.C11H21N.C2H6/c1-12(2,3)11-10-7-9(10)8-14(11)13(4,5)6;1-8-6-11(5)7-9(11)12(8)10(2,3)4;1-2/h9-11H,7-8H2,1-6H3;8-9H,6-7H2,1-5H3;1-2H3/t9-,10-,11?;8-,9-,11+;/m11./s1 |
| InChIKey | UURAPICXQWVQKB-JJPSMUQNSA-N |
| XLogP | 6.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.72 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |