About 1-(2,2-dimethylpropyl)-2-(4-methylphenyl)benzene;methane
1-(2,2-dimethylpropyl)-2-(4-methylphenyl)benzene;methane (PubChem CID 161201714) has the molecular formula C19H26
and a molecular weight of 254.42 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-2-(4-methylphenyl)benzene;methane.
Molecular Properties
| Compound Name | 1-(2,2-dimethylpropyl)-2-(4-methylphenyl)benzene;methane |
| PubChem CID | 161201714 |
| Molecular Formula | C19H26 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-2-(4-methylphenyl)benzene;methane |
| SMILES | C.Cc1ccc(-c2ccccc2CC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H22.CH4/c1-14-9-11-15(12-10-14)17-8-6-5-7-16(17)13-18(2,3)4;/h5-12H,13H2,1-4H3;1H4 |
| InChIKey | UVBITHZZNMKLCD-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(2,2-dimethylpropyl)-2-(4-methylphenyl)benzene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethylpropyl)-2-(4-methylphenyl)benzene;methane?
The IUPAC name of 1-(2,2-dimethylpropyl)-2-(4-methylphenyl)benzene;methane (CID 161201714) is 1-(2,2-dimethylpropyl)-2-(4-methylphenyl)benzene;methane.
What is the SMILES notation for 1-(2,2-dimethylpropyl)-2-(4-methylphenyl)benzene;methane?
The canonical SMILES for 1-(2,2-dimethylpropyl)-2-(4-methylphenyl)benzene;methane is C.Cc1ccc(-c2ccccc2CC(C)(C)C)cc1.
What is the InChIKey of 1-(2,2-dimethylpropyl)-2-(4-methylphenyl)benzene;methane?
The InChIKey is UVBITHZZNMKLCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22.CH4/c1-14-9-11-15(12-10-14)17-8-6-5-7-16(17)13-18(2,3)4;/h5-12H,13H2,1-4H3;1H4.
What are the key properties of 1-(2,2-dimethylpropyl)-2-(4-methylphenyl)benzene;methane?
1-(2,2-dimethylpropyl)-2-(4-methylphenyl)benzene;methane has a molecular weight of 254.42 g/mol, XLogP of 5.89, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylpropyl)-2-(4-methylphenyl)benzene;methane is sourced from PubChem (CID 161201714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).