C38H42N4O7S — CID 161203174
1-(2-methylpropanoyloxy)ethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[2-[4-(N'-ethylsulfanylcarbonylcarbamimidoyl)phenyl]acetyl]-5-methylphenyl]pyridine-2-carboxylate (PubChem CID 161203174) has the molecular formula C38H42N4O7S and a molecular weight of 698.84 g/mol. Its IUPAC name is 1-(2-methylpropanoyloxy)ethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[2-[4-(N'-ethylsulfanylcarbonylcarbamimidoyl)phenyl]acetyl]-5-methylphenyl]pyridine-2-carboxylate.
| Compound Name | 1-(2-methylpropanoyloxy)ethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[2-[4-(N'-ethylsulfanylcarbonylcarbamimidoyl)phenyl]acetyl]-5-methylphenyl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 161203174 |
| Molecular Formula | C38H42N4O7S |
| Molecular Weight | 698.84 g/mol |
| Exact Mass | 698.28 |
| IUPAC Name | 1-(2-methylpropanoyloxy)ethyl 6-(cyclopropylmethylcarbamoyl)-3-[4-ethenyl-2-[2-[4-(N'-ethylsulfanylcarbonylcarbamimidoyl)phenyl]acetyl]-5-methylphenyl]pyridine-2-carboxylate |
| SMILES | C=Cc1cc(C(=O)Cc2ccc(C(N)=NC(=O)SCC)cc2)c(-c2ccc(C(=O)NCC3CC3)nc2C(=O)OC(C)OC(=O)C(C)C)cc1C |
| InChI | InChI=1S/C38H42N4O7S/c1-7-26-19-30(32(43)18-24-11-13-27(14-12-24)34(39)42-38(47)50-8-2)29(17-22(26)5)28-15-16-31(35(44)40-20-25-9-10-25)41-33(28)37(46)49-23(6)48-36(45)21(3)4/h7,11-17,19,21,23,25H,1,8-10,18,20H2,2-6H3,(H,40,44)(H2,39,42,47) |
| InChIKey | IGRYRGOJEVFGJI-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 167.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.84 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|