C23H36ClN3O3 — CID 161203326
7-[2-chloro-6-(diethoxymethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2,2,8-trimethylnonan-4-one (PubChem CID 161203326) has the molecular formula C23H36ClN3O3 and a molecular weight of 438.01 g/mol. Its IUPAC name is 7-[2-chloro-6-(diethoxymethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2,2,8-trimethylnonan-4-one.
| Compound Name | 7-[2-chloro-6-(diethoxymethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2,2,8-trimethylnonan-4-one |
|---|---|
| PubChem CID | 161203326 |
| Molecular Formula | C23H36ClN3O3 |
| Molecular Weight | 438.01 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | 7-[2-chloro-6-(diethoxymethyl)pyrrolo[2,3-d]pyrimidin-7-yl]-2,2,8-trimethylnonan-4-one |
| SMILES | CCOC(OCC)c1cc2cnc(Cl)nc2n1C(CCC(=O)CC(C)(C)C)C(C)C |
| InChI | InChI=1S/C23H36ClN3O3/c1-8-29-21(30-9-2)19-12-16-14-25-22(24)26-20(16)27(19)18(15(3)4)11-10-17(28)13-23(5,6)7/h12,14-15,18,21H,8-11,13H2,1-7H3 |
| InChIKey | UVGTUVBXJXPDRW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.01 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|