About ethyl 5-methyl-4-phenylthiophene-2-carboxylate;5-methyl-4-phenylthiophene-2-carboxylic acid
ethyl 5-methyl-4-phenylthiophene-2-carboxylate;5-methyl-4-phenylthiophene-2-carboxylic acid (PubChem CID 161205106) has the molecular formula C26H24O4S2
and a molecular weight of 464.61 g/mol. Its IUPAC name is ethyl 5-methyl-4-phenylthiophene-2-carboxylate;5-methyl-4-phenylthiophene-2-carboxylic acid.
Molecular Properties
| Compound Name | ethyl 5-methyl-4-phenylthiophene-2-carboxylate;5-methyl-4-phenylthiophene-2-carboxylic acid |
| PubChem CID | 161205106 |
| Molecular Formula | C26H24O4S2 |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | ethyl 5-methyl-4-phenylthiophene-2-carboxylate;5-methyl-4-phenylthiophene-2-carboxylic acid |
| SMILES | CCOC(=O)c1cc(-c2ccccc2)c(C)s1.Cc1sc(C(=O)O)cc1-c1ccccc1 |
| InChI | InChI=1S/C14H14O2S.C12H10O2S/c1-3-16-14(15)13-9-12(10(2)17-13)11-7-5-4-6-8-11;1-8-10(7-11(15-8)12(13)14)9-5-3-2-4-6-9/h4-9H,3H2,1-2H3;2-7H,1H3,(H,13,14) |
| InChIKey | UVMMFQVVZXVQEK-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-methyl-4-phenylthiophene-2-carboxylate;5-methyl-4-phenylthiophene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-methyl-4-phenylthiophene-2-carboxylate;5-methyl-4-phenylthiophene-2-carboxylic acid?
The IUPAC name of ethyl 5-methyl-4-phenylthiophene-2-carboxylate;5-methyl-4-phenylthiophene-2-carboxylic acid (CID 161205106) is ethyl 5-methyl-4-phenylthiophene-2-carboxylate;5-methyl-4-phenylthiophene-2-carboxylic acid.
What is the SMILES notation for ethyl 5-methyl-4-phenylthiophene-2-carboxylate;5-methyl-4-phenylthiophene-2-carboxylic acid?
The canonical SMILES for ethyl 5-methyl-4-phenylthiophene-2-carboxylate;5-methyl-4-phenylthiophene-2-carboxylic acid is CCOC(=O)c1cc(-c2ccccc2)c(C)s1.Cc1sc(C(=O)O)cc1-c1ccccc1.
What is the InChIKey of ethyl 5-methyl-4-phenylthiophene-2-carboxylate;5-methyl-4-phenylthiophene-2-carboxylic acid?
The InChIKey is UVMMFQVVZXVQEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O2S.C12H10O2S/c1-3-16-14(15)13-9-12(10(2)17-13)11-7-5-4-6-8-11;1-8-10(7-11(15-8)12(13)14)9-5-3-2-4-6-9/h4-9H,3H2,1-2H3;2-7H,1H3,(H,13,14).
What are the key properties of ethyl 5-methyl-4-phenylthiophene-2-carboxylate;5-methyl-4-phenylthiophene-2-carboxylic acid?
ethyl 5-methyl-4-phenylthiophene-2-carboxylate;5-methyl-4-phenylthiophene-2-carboxylic acid has a molecular weight of 464.61 g/mol, XLogP of 7.32, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-methyl-4-phenylthiophene-2-carboxylate;5-methyl-4-phenylthiophene-2-carboxylic acid is sourced from PubChem (CID 161205106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).