About 3-(methylamino)propane-1,2-diol;molecular iodine;yttrium
3-(methylamino)propane-1,2-diol;molecular iodine;yttrium (PubChem CID 161205708) has the molecular formula C4H11I2NO2Y
and a molecular weight of 447.85 g/mol. Its IUPAC name is 3-(methylamino)propane-1,2-diol;molecular iodine;yttrium.
Molecular Properties
| Compound Name | 3-(methylamino)propane-1,2-diol;molecular iodine;yttrium |
| PubChem CID | 161205708 |
| Molecular Formula | C4H11I2NO2Y |
| Molecular Weight | 447.85 g/mol |
| Exact Mass | 447.79 |
| IUPAC Name | 3-(methylamino)propane-1,2-diol;molecular iodine;yttrium |
| SMILES | CNCC(O)CO.II.[Y] |
| InChI | InChI=1S/C4H11NO2.I2.Y/c1-5-2-4(7)3-6;1-2;/h4-7H,2-3H2,1H3;; |
| InChIKey | CKADGRWSZZBIEK-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 447.85 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(methylamino)propane-1,2-diol;molecular iodine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(methylamino)propane-1,2-diol;molecular iodine;yttrium?
The IUPAC name of 3-(methylamino)propane-1,2-diol;molecular iodine;yttrium (CID 161205708) is 3-(methylamino)propane-1,2-diol;molecular iodine;yttrium.
What is the SMILES notation for 3-(methylamino)propane-1,2-diol;molecular iodine;yttrium?
The canonical SMILES for 3-(methylamino)propane-1,2-diol;molecular iodine;yttrium is CNCC(O)CO.II.[Y].
What is the InChIKey of 3-(methylamino)propane-1,2-diol;molecular iodine;yttrium?
The InChIKey is CKADGRWSZZBIEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11NO2.I2.Y/c1-5-2-4(7)3-6;1-2;/h4-7H,2-3H2,1H3;;.
What are the key properties of 3-(methylamino)propane-1,2-diol;molecular iodine;yttrium?
3-(methylamino)propane-1,2-diol;molecular iodine;yttrium has a molecular weight of 447.85 g/mol, XLogP of 0.33, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(methylamino)propane-1,2-diol;molecular iodine;yttrium is sourced from PubChem (CID 161205708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).