About 1-ethylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione
1-ethylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione (PubChem CID 161206653) has the molecular formula C11H14N2O4
and a molecular weight of 238.24 g/mol. Its IUPAC name is 1-ethylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione.
Molecular Properties
| Compound Name | 1-ethylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione |
| PubChem CID | 161206653 |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 1-ethylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione |
| SMILES | CCN1C(=O)CCC1=O.CN1C(=O)C=CC1=O |
| InChI | InChI=1S/C6H9NO2.C5H5NO2/c1-2-7-5(8)3-4-6(7)9;1-6-4(7)2-3-5(6)8/h2-4H2,1H3;2-3H,1H3 |
| InChIKey | UVRLUHTZNHKEDQ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-ethylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione?
The IUPAC name of 1-ethylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione (CID 161206653) is 1-ethylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione.
What is the SMILES notation for 1-ethylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione?
The canonical SMILES for 1-ethylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione is CCN1C(=O)CCC1=O.CN1C(=O)C=CC1=O.
What is the InChIKey of 1-ethylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione?
The InChIKey is UVRLUHTZNHKEDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9NO2.C5H5NO2/c1-2-7-5(8)3-4-6(7)9;1-6-4(7)2-3-5(6)8/h2-4H2,1H3;2-3H,1H3.
What are the key properties of 1-ethylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione?
1-ethylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione has a molecular weight of 238.24 g/mol, XLogP of -0.30, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpyrrolidine-2,5-dione;1-methylpyrrole-2,5-dione is sourced from PubChem (CID 161206653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).