C34H43N5O7 — CID 161207379
3-azidohexan-2-one;(3R,4S)-4-[[4-[2-(2-benzyl-5-methyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]-1-ethoxycarbonylpyrrolidine-3-carboxylic acid (PubChem CID 161207379) has the molecular formula C34H43N5O7 and a molecular weight of 633.75 g/mol. Its IUPAC name is 3-azidohexan-2-one;(3R,4S)-4-[[4-[2-(2-benzyl-5-methyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]-1-ethoxycarbonylpyrrolidine-3-carboxylic acid.
| Compound Name | 3-azidohexan-2-one;(3R,4S)-4-[[4-[2-(2-benzyl-5-methyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]-1-ethoxycarbonylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 161207379 |
| Molecular Formula | C34H43N5O7 |
| Molecular Weight | 633.75 g/mol |
| Exact Mass | 633.32 |
| IUPAC Name | 3-azidohexan-2-one;(3R,4S)-4-[[4-[2-(2-benzyl-5-methyl-1,3-oxazol-4-yl)ethoxy]phenyl]methyl]-1-ethoxycarbonylpyrrolidine-3-carboxylic acid |
| SMILES | CCCC(N=[N+]=[N-])C(C)=O.CCOC(=O)N1C[C@@H](Cc2ccc(OCCc3nc(Cc4ccccc4)oc3C)cc2)[C@@H](C(=O)O)C1 |
| InChI | InChI=1S/C28H32N2O6.C6H11N3O/c1-3-34-28(33)30-17-22(24(18-30)27(31)32)15-21-9-11-23(12-10-21)35-14-13-25-19(2)36-26(29-25)16-20-7-5-4-6-8-20;1-3-4-6(5(2)10)8-9-7/h4-12,22,24H,3,13-18H2,1-2H3,(H,31,32);6H,3-4H2,1-2H3/t22-,24+;/m1./s1 |
| InChIKey | UVUBNLSAUGDDAR-UTSIGBCTSA-N |
| XLogP | 6.58 |
| TPSA | 167.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.75 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|