About 1-[4-(5-chloro-3-methyl-1,2-benzoxazol-7-yl)-2,2-dimethylpiperazin-1-yl]ethanone
1-[4-(5-chloro-3-methyl-1,2-benzoxazol-7-yl)-2,2-dimethylpiperazin-1-yl]ethanone (PubChem CID 161208660) has the molecular formula C16H20ClN3O2
and a molecular weight of 321.81 g/mol. Its IUPAC name is 1-[4-(5-chloro-3-methyl-1,2-benzoxazol-7-yl)-2,2-dimethylpiperazin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-(5-chloro-3-methyl-1,2-benzoxazol-7-yl)-2,2-dimethylpiperazin-1-yl]ethanone |
| PubChem CID | 161208660 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 1-[4-(5-chloro-3-methyl-1,2-benzoxazol-7-yl)-2,2-dimethylpiperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2cc(Cl)cc3c(C)noc23)CC1(C)C |
| InChI | InChI=1S/C16H20ClN3O2/c1-10-13-7-12(17)8-14(15(13)22-18-10)19-5-6-20(11(2)21)16(3,4)9-19/h7-8H,5-6,9H2,1-4H3 |
| InChIKey | QHUVLGXUUSSUHK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(5-chloro-3-methyl-1,2-benzoxazol-7-yl)-2,2-dimethylpiperazin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(5-chloro-3-methyl-1,2-benzoxazol-7-yl)-2,2-dimethylpiperazin-1-yl]ethanone?
The IUPAC name of 1-[4-(5-chloro-3-methyl-1,2-benzoxazol-7-yl)-2,2-dimethylpiperazin-1-yl]ethanone (CID 161208660) is 1-[4-(5-chloro-3-methyl-1,2-benzoxazol-7-yl)-2,2-dimethylpiperazin-1-yl]ethanone.
What is the SMILES notation for 1-[4-(5-chloro-3-methyl-1,2-benzoxazol-7-yl)-2,2-dimethylpiperazin-1-yl]ethanone?
The canonical SMILES for 1-[4-(5-chloro-3-methyl-1,2-benzoxazol-7-yl)-2,2-dimethylpiperazin-1-yl]ethanone is CC(=O)N1CCN(c2cc(Cl)cc3c(C)noc23)CC1(C)C.
What is the InChIKey of 1-[4-(5-chloro-3-methyl-1,2-benzoxazol-7-yl)-2,2-dimethylpiperazin-1-yl]ethanone?
The InChIKey is QHUVLGXUUSSUHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20ClN3O2/c1-10-13-7-12(17)8-14(15(13)22-18-10)19-5-6-20(11(2)21)16(3,4)9-19/h7-8H,5-6,9H2,1-4H3.
What are the key properties of 1-[4-(5-chloro-3-methyl-1,2-benzoxazol-7-yl)-2,2-dimethylpiperazin-1-yl]ethanone?
1-[4-(5-chloro-3-methyl-1,2-benzoxazol-7-yl)-2,2-dimethylpiperazin-1-yl]ethanone has a molecular weight of 321.81 g/mol, XLogP of 3.24, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(5-chloro-3-methyl-1,2-benzoxazol-7-yl)-2,2-dimethylpiperazin-1-yl]ethanone is sourced from PubChem (CID 161208660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).