C21H32FN5O5S — CID 161209291
2-[(2R,3S)-3-[[4-(1,3-dimethoxypropan-2-yl)-5-[(2R,5R)-5-methyloxolan-2-yl]-1,2,4-triazol-3-yl]methylsulfonyl]butan-2-yl]-5-fluoropyrimidine (PubChem CID 161209291) has the molecular formula C21H32FN5O5S and a molecular weight of 485.58 g/mol. Its IUPAC name is 2-[(2R,3S)-3-[[4-(1,3-dimethoxypropan-2-yl)-5-[(2R,5R)-5-methyloxolan-2-yl]-1,2,4-triazol-3-yl]methylsulfonyl]butan-2-yl]-5-fluoropyrimidine.
| Compound Name | 2-[(2R,3S)-3-[[4-(1,3-dimethoxypropan-2-yl)-5-[(2R,5R)-5-methyloxolan-2-yl]-1,2,4-triazol-3-yl]methylsulfonyl]butan-2-yl]-5-fluoropyrimidine |
|---|---|
| PubChem CID | 161209291 |
| Molecular Formula | C21H32FN5O5S |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.21 |
| IUPAC Name | 2-[(2R,3S)-3-[[4-(1,3-dimethoxypropan-2-yl)-5-[(2R,5R)-5-methyloxolan-2-yl]-1,2,4-triazol-3-yl]methylsulfonyl]butan-2-yl]-5-fluoropyrimidine |
| SMILES | COCC(COC)n1c(CS(=O)(=O)[C@@H](C)[C@H](C)c2ncc(F)cn2)nnc1[C@H]1CC[C@@H](C)O1 |
| InChI | InChI=1S/C21H32FN5O5S/c1-13-6-7-18(32-13)21-26-25-19(27(21)17(10-30-4)11-31-5)12-33(28,29)15(3)14(2)20-23-8-16(22)9-24-20/h8-9,13-15,17-18H,6-7,10-12H2,1-5H3/t13-,14+,15+,18-/m1/s1 |
| InChIKey | CPTJFCALPXVHQY-LDDOYCOJSA-N |
| XLogP | 2.39 |
| TPSA | 118.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |