About 1-phenyl-3,6-dipyridin-3-yl-6,7-dihydroindazole
1-phenyl-3,6-dipyridin-3-yl-6,7-dihydroindazole (PubChem CID 161209606) has the molecular formula C23H18N4
and a molecular weight of 350.43 g/mol. Its IUPAC name is 1-phenyl-3,6-dipyridin-3-yl-6,7-dihydroindazole.
Molecular Properties
| Compound Name | 1-phenyl-3,6-dipyridin-3-yl-6,7-dihydroindazole |
| PubChem CID | 161209606 |
| Molecular Formula | C23H18N4 |
| Molecular Weight | 350.43 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | 1-phenyl-3,6-dipyridin-3-yl-6,7-dihydroindazole |
| SMILES | C1=CC(c2cccnc2)Cc2c1c(-c1cccnc1)nn2-c1ccccc1 |
| InChI | InChI=1S/C23H18N4/c1-2-8-20(9-3-1)27-22-14-17(18-6-4-12-24-15-18)10-11-21(22)23(26-27)19-7-5-13-25-16-19/h1-13,15-17H,14H2 |
| InChIKey | NNFMLNUSXAQCTK-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.43 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-phenyl-3,6-dipyridin-3-yl-6,7-dihydroindazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-3,6-dipyridin-3-yl-6,7-dihydroindazole?
The IUPAC name of 1-phenyl-3,6-dipyridin-3-yl-6,7-dihydroindazole (CID 161209606) is 1-phenyl-3,6-dipyridin-3-yl-6,7-dihydroindazole.
What is the SMILES notation for 1-phenyl-3,6-dipyridin-3-yl-6,7-dihydroindazole?
The canonical SMILES for 1-phenyl-3,6-dipyridin-3-yl-6,7-dihydroindazole is C1=CC(c2cccnc2)Cc2c1c(-c1cccnc1)nn2-c1ccccc1.
What is the InChIKey of 1-phenyl-3,6-dipyridin-3-yl-6,7-dihydroindazole?
The InChIKey is NNFMLNUSXAQCTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N4/c1-2-8-20(9-3-1)27-22-14-17(18-6-4-12-24-15-18)10-11-21(22)23(26-27)19-7-5-13-25-16-19/h1-13,15-17H,14H2.
What are the key properties of 1-phenyl-3,6-dipyridin-3-yl-6,7-dihydroindazole?
1-phenyl-3,6-dipyridin-3-yl-6,7-dihydroindazole has a molecular weight of 350.43 g/mol, XLogP of 4.68, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-3,6-dipyridin-3-yl-6,7-dihydroindazole is sourced from PubChem (CID 161209606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).