C34H54N4O9 — CID 161210552
(3S,6R,9S,12R,15S,18R)-6-benzyl-3,9-di(butan-2-yl)-4,10,12,15,16,18-hexamethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone;methanamine (PubChem CID 161210552) has the molecular formula C34H54N4O9 and a molecular weight of 662.83 g/mol. Its IUPAC name is (3S,6R,9S,12R,15S,18R)-6-benzyl-3,9-di(butan-2-yl)-4,10,12,15,16,18-hexamethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone;methanamine.
| Compound Name | (3S,6R,9S,12R,15S,18R)-6-benzyl-3,9-di(butan-2-yl)-4,10,12,15,16,18-hexamethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone;methanamine |
|---|---|
| PubChem CID | 161210552 |
| Molecular Formula | C34H54N4O9 |
| Molecular Weight | 662.83 g/mol |
| Exact Mass | 662.39 |
| IUPAC Name | (3S,6R,9S,12R,15S,18R)-6-benzyl-3,9-di(butan-2-yl)-4,10,12,15,16,18-hexamethyl-1,7,13-trioxa-4,10,16-triazacyclooctadecane-2,5,8,11,14,17-hexone;methanamine |
| SMILES | CCC(C)[C@H]1C(=O)O[C@H](Cc2ccccc2)C(=O)N(C)[C@@H](C(C)CC)C(=O)O[C@H](C)C(=O)N(C)[C@@H](C)C(=O)O[C@H](C)C(=O)N1C.CN |
| InChI | InChI=1S/C33H49N3O9.CH5N/c1-11-19(3)26-32(41)44-22(6)28(37)34(8)21(5)31(40)43-23(7)29(38)35(9)27(20(4)12-2)33(42)45-25(30(39)36(26)10)18-24-16-14-13-15-17-24;1-2/h13-17,19-23,25-27H,11-12,18H2,1-10H3;2H2,1H3/t19?,20?,21-,22+,23+,25+,26-,27-;/m0./s1 |
| InChIKey | UWEFAULVNNXJMP-KODXZJDDSA-N |
| XLogP | 2.19 |
| TPSA | 165.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.83 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|