About 3-methylhex-5-en-2-one;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane
3-methylhex-5-en-2-one;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane (PubChem CID 161211435) has the molecular formula C16H28O3
and a molecular weight of 268.40 g/mol. Its IUPAC name is 3-methylhex-5-en-2-one;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane.
Molecular Properties
| Compound Name | 3-methylhex-5-en-2-one;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane |
| PubChem CID | 161211435 |
| Molecular Formula | C16H28O3 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 3-methylhex-5-en-2-one;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane |
| SMILES | C=CCC(C)C(C)=O.C=CCC(C)C1(C)OCCO1 |
| InChI | InChI=1S/C9H16O2.C7H12O/c1-4-5-8(2)9(3)10-6-7-11-9;1-4-5-6(2)7(3)8/h4,8H,1,5-7H2,2-3H3;4,6H,1,5H2,2-3H3 |
| InChIKey | UWHAXTFQCIGRJA-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-methylhex-5-en-2-one;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylhex-5-en-2-one;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane?
The IUPAC name of 3-methylhex-5-en-2-one;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane (CID 161211435) is 3-methylhex-5-en-2-one;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane.
What is the SMILES notation for 3-methylhex-5-en-2-one;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane?
The canonical SMILES for 3-methylhex-5-en-2-one;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane is C=CCC(C)C(C)=O.C=CCC(C)C1(C)OCCO1.
What is the InChIKey of 3-methylhex-5-en-2-one;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane?
The InChIKey is UWHAXTFQCIGRJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2.C7H12O/c1-4-5-8(2)9(3)10-6-7-11-9;1-4-5-6(2)7(3)8/h4,8H,1,5-7H2,2-3H3;4,6H,1,5H2,2-3H3.
What are the key properties of 3-methylhex-5-en-2-one;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane?
3-methylhex-5-en-2-one;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane has a molecular weight of 268.40 g/mol, XLogP of 3.75, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylhex-5-en-2-one;2-methyl-2-pent-4-en-2-yl-1,3-dioxolane is sourced from PubChem (CID 161211435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).