About 1-(7-methyl-5,6,7,8-tetrahydroindolizin-2-yl)ethanone
1-(7-methyl-5,6,7,8-tetrahydroindolizin-2-yl)ethanone (PubChem CID 161214249) has the molecular formula C11H15NO
and a molecular weight of 177.25 g/mol. Its IUPAC name is 1-(7-methyl-5,6,7,8-tetrahydroindolizin-2-yl)ethanone.
Analyze 1-(7-methyl-5,6,7,8-tetrahydroindolizin-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-methyl-5,6,7,8-tetrahydroindolizin-2-yl)ethanone?
The IUPAC name of 1-(7-methyl-5,6,7,8-tetrahydroindolizin-2-yl)ethanone (CID 161214249) is 1-(7-methyl-5,6,7,8-tetrahydroindolizin-2-yl)ethanone.
What is the SMILES notation for 1-(7-methyl-5,6,7,8-tetrahydroindolizin-2-yl)ethanone?
The canonical SMILES for 1-(7-methyl-5,6,7,8-tetrahydroindolizin-2-yl)ethanone is CC(=O)c1cc2n(c1)CCC(C)C2.
What is the InChIKey of 1-(7-methyl-5,6,7,8-tetrahydroindolizin-2-yl)ethanone?
The InChIKey is WOKPOMQXOWWMMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO/c1-8-3-4-12-7-10(9(2)13)6-11(12)5-8/h6-8H,3-5H2,1-2H3.
What are the key properties of 1-(7-methyl-5,6,7,8-tetrahydroindolizin-2-yl)ethanone?
1-(7-methyl-5,6,7,8-tetrahydroindolizin-2-yl)ethanone has a molecular weight of 177.25 g/mol, XLogP of 2.27, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-methyl-5,6,7,8-tetrahydroindolizin-2-yl)ethanone is sourced from PubChem (CID 161214249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).