C10H17NO2S — CID 161215261
1,2,5-trimethyl-6-methylsulfonyl-4,5-dihydroazepine (PubChem CID 161215261) has the molecular formula C10H17NO2S and a molecular weight of 215.32 g/mol. Its IUPAC name is 1,2,5-trimethyl-6-methylsulfonyl-4,5-dihydroazepine.
| Compound Name | 1,2,5-trimethyl-6-methylsulfonyl-4,5-dihydroazepine |
|---|---|
| PubChem CID | 161215261 |
| Molecular Formula | C10H17NO2S |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 1,2,5-trimethyl-6-methylsulfonyl-4,5-dihydroazepine |
| SMILES | CC1=CCC(C)C(S(C)(=O)=O)=CN1C |
| InChI | InChI=1S/C10H17NO2S/c1-8-5-6-9(2)11(3)7-10(8)14(4,12)13/h6-8H,5H2,1-4H3 |
| InChIKey | UWTUPAOIMNZRFF-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |