C23H23F3N4O6S — CID 161215569
(2S)-2-amino-N-[(2S)-1-amino-1-oxo-3-[4-(1,1,3-trioxo-1,2-thiazol-5-yl)phenyl]propan-2-yl]-3-phenylpropanamide;2,2,2-trifluoroacetaldehyde (PubChem CID 161215569) has the molecular formula C23H23F3N4O6S and a molecular weight of 540.52 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-1-amino-1-oxo-3-[4-(1,1,3-trioxo-1,2-thiazol-5-yl)phenyl]propan-2-yl]-3-phenylpropanamide;2,2,2-trifluoroacetaldehyde.
| Compound Name | (2S)-2-amino-N-[(2S)-1-amino-1-oxo-3-[4-(1,1,3-trioxo-1,2-thiazol-5-yl)phenyl]propan-2-yl]-3-phenylpropanamide;2,2,2-trifluoroacetaldehyde |
|---|---|
| PubChem CID | 161215569 |
| Molecular Formula | C23H23F3N4O6S |
| Molecular Weight | 540.52 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-1-amino-1-oxo-3-[4-(1,1,3-trioxo-1,2-thiazol-5-yl)phenyl]propan-2-yl]-3-phenylpropanamide;2,2,2-trifluoroacetaldehyde |
| SMILES | NC(=O)[C@H](Cc1ccc(C2=CC(=O)NS2(=O)=O)cc1)NC(=O)[C@@H](N)Cc1ccccc1.O=CC(F)(F)F |
| InChI | InChI=1S/C21H22N4O5S.C2HF3O/c22-16(10-13-4-2-1-3-5-13)21(28)24-17(20(23)27)11-14-6-8-15(9-7-14)18-12-19(26)25-31(18,29)30;3-2(4,5)1-6/h1-9,12,16-17H,10-11,22H2,(H2,23,27)(H,24,28)(H,25,26);1H/t16-,17-;/m0./s1 |
| InChIKey | UWUUBHHLEIKWMS-QJHJCNPRSA-N |
| XLogP | 0.32 |
| TPSA | 178.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.52 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|