C28H28N2O9 — CID 161216352
(3E)-1-ethyl-3-[(E)-3-(furan-2-yl)prop-2-enylidene]piperidine-2,4,6-trione;1-ethylpiperidine-2,4,6-trione;(E)-3-(furan-2-yl)prop-2-enal (PubChem CID 161216352) has the molecular formula C28H28N2O9 and a molecular weight of 536.54 g/mol. Its IUPAC name is (3E)-1-ethyl-3-[(E)-3-(furan-2-yl)prop-2-enylidene]piperidine-2,4,6-trione;1-ethylpiperidine-2,4,6-trione;(E)-3-(furan-2-yl)prop-2-enal.
| Compound Name | (3E)-1-ethyl-3-[(E)-3-(furan-2-yl)prop-2-enylidene]piperidine-2,4,6-trione;1-ethylpiperidine-2,4,6-trione;(E)-3-(furan-2-yl)prop-2-enal |
|---|---|
| PubChem CID | 161216352 |
| Molecular Formula | C28H28N2O9 |
| Molecular Weight | 536.54 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | (3E)-1-ethyl-3-[(E)-3-(furan-2-yl)prop-2-enylidene]piperidine-2,4,6-trione;1-ethylpiperidine-2,4,6-trione;(E)-3-(furan-2-yl)prop-2-enal |
| SMILES | CCN1C(=O)CC(=O)/C(=C\C=C\c2ccco2)C1=O.CCN1C(=O)CC(=O)CC1=O.O=C/C=C/c1ccco1 |
| InChI | InChI=1S/C14H13NO4.C7H9NO3.C7H6O2/c1-2-15-13(17)9-12(16)11(14(15)18)7-3-5-10-6-4-8-19-10;1-2-8-6(10)3-5(9)4-7(8)11;8-5-1-3-7-4-2-6-9-7/h3-8H,2,9H2,1H3;2-4H2,1H3;1-6H/b5-3+,11-7+;;3-1+ |
| InChIKey | UWXNGTGECWJFDU-YONKPIJHSA-N |
| XLogP | 2.78 |
| TPSA | 152.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|