C14H14F3N3O5 — CID 161216373
3-methyl-3-[4-(1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]butanoic acid;2,2,2-trifluoroacetate (PubChem CID 161216373) has the molecular formula C14H14F3N3O5 and a molecular weight of 361.28 g/mol. Its IUPAC name is 3-methyl-3-[4-(1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]butanoic acid;2,2,2-trifluoroacetate.
| Compound Name | 3-methyl-3-[4-(1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]butanoic acid;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 161216373 |
| Molecular Formula | C14H14F3N3O5 |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 3-methyl-3-[4-(1,3-oxazol-2-yl)pyridazin-1-ium-1-yl]butanoic acid;2,2,2-trifluoroacetate |
| SMILES | CC(C)(CC(=O)O)[n+]1ccc(-c2ncco2)cn1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C12H13N3O3.C2HF3O2/c1-12(2,7-10(16)17)15-5-3-9(8-14-15)11-13-4-6-18-11;3-2(4,5)1(6)7/h3-6,8H,7H2,1-2H3;(H,6,7) |
| InChIKey | KLLOQJRJHSKFEK-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 120.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|