About fluoromethane;2-propan-2-ylpyrimidine
fluoromethane;2-propan-2-ylpyrimidine (PubChem CID 161216719) has the molecular formula C8H13FN2
and a molecular weight of 156.20 g/mol. Its IUPAC name is fluoromethane;2-propan-2-ylpyrimidine.
Molecular Properties
| Compound Name | fluoromethane;2-propan-2-ylpyrimidine |
| PubChem CID | 161216719 |
| Molecular Formula | C8H13FN2 |
| Molecular Weight | 156.20 g/mol |
| Exact Mass | 156.11 |
| IUPAC Name | fluoromethane;2-propan-2-ylpyrimidine |
| SMILES | CC(C)c1ncccn1.CF |
| InChI | InChI=1S/C7H10N2.CH3F/c1-6(2)7-8-4-3-5-9-7;1-2/h3-6H,1-2H3;1H3 |
| InChIKey | UWYSJKPXEAWSCF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.20 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze fluoromethane;2-propan-2-ylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoromethane;2-propan-2-ylpyrimidine?
The IUPAC name of fluoromethane;2-propan-2-ylpyrimidine (CID 161216719) is fluoromethane;2-propan-2-ylpyrimidine.
What is the SMILES notation for fluoromethane;2-propan-2-ylpyrimidine?
The canonical SMILES for fluoromethane;2-propan-2-ylpyrimidine is CC(C)c1ncccn1.CF.
What is the InChIKey of fluoromethane;2-propan-2-ylpyrimidine?
The InChIKey is UWYSJKPXEAWSCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2.CH3F/c1-6(2)7-8-4-3-5-9-7;1-2/h3-6H,1-2H3;1H3.
What are the key properties of fluoromethane;2-propan-2-ylpyrimidine?
fluoromethane;2-propan-2-ylpyrimidine has a molecular weight of 156.20 g/mol, XLogP of 2.19, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoromethane;2-propan-2-ylpyrimidine is sourced from PubChem (CID 161216719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).