C9H9O2Y- — CID 161217066
2,3,5-trimethylcyclohexa-2,5-diene-1,4-dione;yttrium (PubChem CID 161217066) has the molecular formula C9H9O2Y- and a molecular weight of 238.07 g/mol. Its IUPAC name is 2,3,5-trimethylcyclohexa-2,5-diene-1,4-dione;yttrium.
| Compound Name | 2,3,5-trimethylcyclohexa-2,5-diene-1,4-dione;yttrium |
|---|---|
| PubChem CID | 161217066 |
| Molecular Formula | C9H9O2Y- |
| Molecular Weight | 238.07 g/mol |
| Exact Mass | 237.97 |
| IUPAC Name | 2,3,5-trimethylcyclohexa-2,5-diene-1,4-dione;yttrium |
| SMILES | CC1=[C-]C(=O)C(C)=C(C)C1=O.[Y] |
| InChI | InChI=1S/C9H9O2.Y/c1-5-4-8(10)6(2)7(3)9(5)11;/h1-3H3;/q-1; |
| InChIKey | IMCSSLLRMSAIBC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.07 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|