About butane-1,4-diamine;N-(5-methylsulfonylpentyl)methanesulfonamide
butane-1,4-diamine;N-(5-methylsulfonylpentyl)methanesulfonamide (PubChem CID 161217358) has the molecular formula C11H29N3O4S2
and a molecular weight of 331.50 g/mol. Its IUPAC name is butane-1,4-diamine;N-(5-methylsulfonylpentyl)methanesulfonamide.
Molecular Properties
| Compound Name | butane-1,4-diamine;N-(5-methylsulfonylpentyl)methanesulfonamide |
| PubChem CID | 161217358 |
| Molecular Formula | C11H29N3O4S2 |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | butane-1,4-diamine;N-(5-methylsulfonylpentyl)methanesulfonamide |
| SMILES | CS(=O)(=O)CCCCCNS(C)(=O)=O.NCCCCN |
| InChI | InChI=1S/C7H17NO4S2.C4H12N2/c1-13(9,10)7-5-3-4-6-8-14(2,11)12;5-3-1-2-4-6/h8H,3-7H2,1-2H3;1-6H2 |
| InChIKey | UXASYFCUNFEJNJ-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 132.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butane-1,4-diamine;N-(5-methylsulfonylpentyl)methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-1,4-diamine;N-(5-methylsulfonylpentyl)methanesulfonamide?
The IUPAC name of butane-1,4-diamine;N-(5-methylsulfonylpentyl)methanesulfonamide (CID 161217358) is butane-1,4-diamine;N-(5-methylsulfonylpentyl)methanesulfonamide.
What is the SMILES notation for butane-1,4-diamine;N-(5-methylsulfonylpentyl)methanesulfonamide?
The canonical SMILES for butane-1,4-diamine;N-(5-methylsulfonylpentyl)methanesulfonamide is CS(=O)(=O)CCCCCNS(C)(=O)=O.NCCCCN.
What is the InChIKey of butane-1,4-diamine;N-(5-methylsulfonylpentyl)methanesulfonamide?
The InChIKey is UXASYFCUNFEJNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H17NO4S2.C4H12N2/c1-13(9,10)7-5-3-4-6-8-14(2,11)12;5-3-1-2-4-6/h8H,3-7H2,1-2H3;1-6H2.
What are the key properties of butane-1,4-diamine;N-(5-methylsulfonylpentyl)methanesulfonamide?
butane-1,4-diamine;N-(5-methylsulfonylpentyl)methanesulfonamide has a molecular weight of 331.50 g/mol, XLogP of -0.57, 10 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butane-1,4-diamine;N-(5-methylsulfonylpentyl)methanesulfonamide is sourced from PubChem (CID 161217358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).