C19H26N4O — CID 161217615
deuterium monohydride;1-methyl-1-(1-methylpiperidin-4-yl)-3-(6-phenyl-3-pyridinyl)urea (PubChem CID 161217615) has the molecular formula C19H26N4O and a molecular weight of 327.45 g/mol. Its IUPAC name is deuterium monohydride;1-methyl-1-(1-methylpiperidin-4-yl)-3-(6-phenyl-3-pyridinyl)urea.
| Compound Name | deuterium monohydride;1-methyl-1-(1-methylpiperidin-4-yl)-3-(6-phenyl-3-pyridinyl)urea |
|---|---|
| PubChem CID | 161217615 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | deuterium monohydride;1-methyl-1-(1-methylpiperidin-4-yl)-3-(6-phenyl-3-pyridinyl)urea |
| SMILES | CN1CCC(N(C)C(=O)Nc2ccc(-c3ccccc3)nc2)CC1.[H][2H] |
| InChI | InChI=1S/C19H24N4O.H2/c1-22-12-10-17(11-13-22)23(2)19(24)21-16-8-9-18(20-14-16)15-6-4-3-5-7-15;/h3-9,14,17H,10-13H2,1-2H3,(H,21,24);1H/i;1+1 |
| InChIKey | UXBRNVLYMBVEDC-IEOVAKBOSA-N |
| XLogP | 3.55 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |