C52H35BrN8O — CID 161217910
2-(5-bromo-7-methyl-1H-indol-3-yl)-3H-pyrrolo[2,3-f][1,10]phenanthroline;2-(5-phenylmethoxy-1H-indol-3-yl)-3H-pyrrolo[2,3-f][1,10]phenanthroline (PubChem CID 161217910) has the molecular formula C52H35BrN8O and a molecular weight of 867.81 g/mol. Its IUPAC name is 2-(5-bromo-7-methyl-1H-indol-3-yl)-3H-pyrrolo[2,3-f][1,10]phenanthroline;2-(5-phenylmethoxy-1H-indol-3-yl)-3H-pyrrolo[2,3-f][1,10]phenanthroline.
| Compound Name | 2-(5-bromo-7-methyl-1H-indol-3-yl)-3H-pyrrolo[2,3-f][1,10]phenanthroline;2-(5-phenylmethoxy-1H-indol-3-yl)-3H-pyrrolo[2,3-f][1,10]phenanthroline |
|---|---|
| PubChem CID | 161217910 |
| Molecular Formula | C52H35BrN8O |
| Molecular Weight | 867.81 g/mol |
| Exact Mass | 866.21 |
| IUPAC Name | 2-(5-bromo-7-methyl-1H-indol-3-yl)-3H-pyrrolo[2,3-f][1,10]phenanthroline;2-(5-phenylmethoxy-1H-indol-3-yl)-3H-pyrrolo[2,3-f][1,10]phenanthroline |
| SMILES | Cc1cc(Br)cc2c(C3=Nc4c(c5cccnc5c5ncccc45)C3)c[nH]c12.c1ccc(COc2ccc3[nH]cc(C4=Nc5c(c6cccnc6c6ncccc56)C4)c3c2)cc1 |
| InChI | InChI=1S/C29H20N4O.C23H15BrN4/c1-2-6-18(7-3-1)17-34-19-10-11-25-22(14-19)24(16-32-25)26-15-23-20-8-4-12-30-28(20)29-21(27(23)33-26)9-5-13-31-29;1-12-8-13(24)9-16-18(11-27-20(12)16)19-10-17-14-4-2-6-25-22(14)23-15(21(17)28-19)5-3-7-26-23/h1-14,16,32H,15,17H2;2-9,11,27H,10H2,1H3 |
| InChIKey | UXCRQPSZPZBPSL-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.81 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|