C15H26Ir — CID 161218097
cycloocta-1,5-diene;ethylcyclopentane;iridium (PubChem CID 161218097) has the molecular formula C15H26Ir and a molecular weight of 398.59 g/mol. Its IUPAC name is cycloocta-1,5-diene;ethylcyclopentane;iridium.
| Compound Name | cycloocta-1,5-diene;ethylcyclopentane;iridium |
|---|---|
| PubChem CID | 161218097 |
| Molecular Formula | C15H26Ir |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | cycloocta-1,5-diene;ethylcyclopentane;iridium |
| SMILES | C1=CCCC=CCC1.CCC1CCCC1.[Ir] |
| InChI | InChI=1S/C8H12.C7H14.Ir/c1-2-4-6-8-7-5-3-1;1-2-7-5-3-4-6-7;/h1-2,7-8H,3-6H2;7H,2-6H2,1H3; |
| InChIKey | SMGGKARUJJWGEF-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|