C42H32N6O6 — CID 161218746
3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione;5,6-bis(4-methoxyanilino)isoindole-1,3-dione (PubChem CID 161218746) has the molecular formula C42H32N6O6 and a molecular weight of 716.75 g/mol. Its IUPAC name is 3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione;5,6-bis(4-methoxyanilino)isoindole-1,3-dione.
| Compound Name | 3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione;5,6-bis(4-methoxyanilino)isoindole-1,3-dione |
|---|---|
| PubChem CID | 161218746 |
| Molecular Formula | C42H32N6O6 |
| Molecular Weight | 716.75 g/mol |
| Exact Mass | 716.24 |
| IUPAC Name | 3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione;5,6-bis(4-methoxyanilino)isoindole-1,3-dione |
| SMILES | COc1ccc(Nc2cc3c(cc2Nc2ccc(OC)cc2)C(=O)NC3=O)cc1.O=C1NC(=O)C(c2c[nH]c3ccccc23)=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H19N3O4.C20H13N3O2/c1-28-15-7-3-13(4-8-15)23-19-11-17-18(22(27)25-21(17)26)12-20(19)24-14-5-9-16(29-2)10-6-14;24-19-17(13-9-21-15-7-3-1-5-11(13)15)18(20(25)23-19)14-10-22-16-8-4-2-6-12(14)16/h3-12,23-24H,1-2H3,(H,25,26,27);1-10,21-22H,(H,23,24,25) |
| InChIKey | UXFKCPZBFZINOM-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 166.44 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.75 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|