About 2-benzyl-5-phenyl-1H-imidazole;2-phenyl-1H-imidazole;2-undecyl-1H-imidazole
2-benzyl-5-phenyl-1H-imidazole;2-phenyl-1H-imidazole;2-undecyl-1H-imidazole (PubChem CID 161219728) has the molecular formula C39H48N6
and a molecular weight of 600.86 g/mol. Its IUPAC name is 2-benzyl-5-phenyl-1H-imidazole;2-phenyl-1H-imidazole;2-undecyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-benzyl-5-phenyl-1H-imidazole;2-phenyl-1H-imidazole;2-undecyl-1H-imidazole |
| PubChem CID | 161219728 |
| Molecular Formula | C39H48N6 |
| Molecular Weight | 600.86 g/mol |
| Exact Mass | 600.39 |
| IUPAC Name | 2-benzyl-5-phenyl-1H-imidazole;2-phenyl-1H-imidazole;2-undecyl-1H-imidazole |
| SMILES | CCCCCCCCCCCc1ncc[nH]1.c1ccc(-c2ncc[nH]2)cc1.c1ccc(Cc2ncc(-c3ccccc3)[nH]2)cc1 |
| InChI | InChI=1S/C16H14N2.C14H26N2.C9H8N2/c1-3-7-13(8-4-1)11-16-17-12-15(18-16)14-9-5-2-6-10-14;1-2-3-4-5-6-7-8-9-10-11-14-15-12-13-16-14;1-2-4-8(5-3-1)9-10-6-7-11-9/h1-10,12H,11H2,(H,17,18);12-13H,2-11H2,1H3,(H,15,16);1-7H,(H,10,11) |
| InChIKey | UXIQSACWLCIADE-UHFFFAOYSA-N |
| XLogP | 10.23 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 600.86 |
| LogP ≤ 5 | 10.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-5-phenyl-1H-imidazole;2-phenyl-1H-imidazole;2-undecyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-5-phenyl-1H-imidazole;2-phenyl-1H-imidazole;2-undecyl-1H-imidazole?
The IUPAC name of 2-benzyl-5-phenyl-1H-imidazole;2-phenyl-1H-imidazole;2-undecyl-1H-imidazole (CID 161219728) is 2-benzyl-5-phenyl-1H-imidazole;2-phenyl-1H-imidazole;2-undecyl-1H-imidazole.
What is the SMILES notation for 2-benzyl-5-phenyl-1H-imidazole;2-phenyl-1H-imidazole;2-undecyl-1H-imidazole?
The canonical SMILES for 2-benzyl-5-phenyl-1H-imidazole;2-phenyl-1H-imidazole;2-undecyl-1H-imidazole is CCCCCCCCCCCc1ncc[nH]1.c1ccc(-c2ncc[nH]2)cc1.c1ccc(Cc2ncc(-c3ccccc3)[nH]2)cc1.
What is the InChIKey of 2-benzyl-5-phenyl-1H-imidazole;2-phenyl-1H-imidazole;2-undecyl-1H-imidazole?
The InChIKey is UXIQSACWLCIADE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14N2.C14H26N2.C9H8N2/c1-3-7-13(8-4-1)11-16-17-12-15(18-16)14-9-5-2-6-10-14;1-2-3-4-5-6-7-8-9-10-11-14-15-12-13-16-14;1-2-4-8(5-3-1)9-10-6-7-11-9/h1-10,12H,11H2,(H,17,18);12-13H,2-11H2,1H3,(H,15,16);1-7H,(H,10,11).
What are the key properties of 2-benzyl-5-phenyl-1H-imidazole;2-phenyl-1H-imidazole;2-undecyl-1H-imidazole?
2-benzyl-5-phenyl-1H-imidazole;2-phenyl-1H-imidazole;2-undecyl-1H-imidazole has a molecular weight of 600.86 g/mol, XLogP of 10.23, 14 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-5-phenyl-1H-imidazole;2-phenyl-1H-imidazole;2-undecyl-1H-imidazole is sourced from PubChem (CID 161219728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).