About silane;tribromo(3-prop-1-enoxypropyl)silane
silane;tribromo(3-prop-1-enoxypropyl)silane (PubChem CID 161219815) has the molecular formula C6H15Br3OSi2
and a molecular weight of 399.07 g/mol. Its IUPAC name is silane;tribromo(3-prop-1-enoxypropyl)silane.
Molecular Properties
| Compound Name | silane;tribromo(3-prop-1-enoxypropyl)silane |
| PubChem CID | 161219815 |
| Molecular Formula | C6H15Br3OSi2 |
| Molecular Weight | 399.07 g/mol |
| Exact Mass | 395.82 |
| IUPAC Name | silane;tribromo(3-prop-1-enoxypropyl)silane |
| SMILES | CC=COCCC[Si](Br)(Br)Br.[SiH4] |
| InChI | InChI=1S/C6H11Br3OSi.H4Si/c1-2-4-10-5-3-6-11(7,8)9;/h2,4H,3,5-6H2,1H3;1H4 |
| InChIKey | UXIYMRDWXODWBF-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.07 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze silane;tribromo(3-prop-1-enoxypropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of silane;tribromo(3-prop-1-enoxypropyl)silane?
The IUPAC name of silane;tribromo(3-prop-1-enoxypropyl)silane (CID 161219815) is silane;tribromo(3-prop-1-enoxypropyl)silane.
What is the SMILES notation for silane;tribromo(3-prop-1-enoxypropyl)silane?
The canonical SMILES for silane;tribromo(3-prop-1-enoxypropyl)silane is CC=COCCC[Si](Br)(Br)Br.[SiH4].
What is the InChIKey of silane;tribromo(3-prop-1-enoxypropyl)silane?
The InChIKey is UXIYMRDWXODWBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11Br3OSi.H4Si/c1-2-4-10-5-3-6-11(7,8)9;/h2,4H,3,5-6H2,1H3;1H4.
What are the key properties of silane;tribromo(3-prop-1-enoxypropyl)silane?
silane;tribromo(3-prop-1-enoxypropyl)silane has a molecular weight of 399.07 g/mol, XLogP of 2.60, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for silane;tribromo(3-prop-1-enoxypropyl)silane is sourced from PubChem (CID 161219815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).