About 1-isocyanonaphthalene
1-isocyanonaphthalene (PubChem CID 16122) has the molecular formula C11H7N
and a molecular weight of 153.18 g/mol. Its IUPAC name is 1-isocyanonaphthalene.
Molecular Properties
| Compound Name | 1-isocyanonaphthalene |
| PubChem CID | 16122 |
| Molecular Formula | C11H7N |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 1-isocyanonaphthalene |
| SMILES | [C-]#[N+]c1cccc2ccccc12 |
| InChI | InChI=1S/C11H7N/c1-12-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H |
| InChIKey | PTCSLGONLAYNQB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanonaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanonaphthalene?
The IUPAC name of 1-isocyanonaphthalene (CID 16122) is 1-isocyanonaphthalene.
What is the SMILES notation for 1-isocyanonaphthalene?
The canonical SMILES for 1-isocyanonaphthalene is [C-]#[N+]c1cccc2ccccc12.
What is the InChIKey of 1-isocyanonaphthalene?
The InChIKey is PTCSLGONLAYNQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N/c1-12-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H.
What are the key properties of 1-isocyanonaphthalene?
1-isocyanonaphthalene has a molecular weight of 153.18 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanonaphthalene is sourced from PubChem (CID 16122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).