C16H16F3N3O4 — CID 161220124
(2R)-3-phenyl-2-[[2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]methoxyamino]propanoic acid (PubChem CID 161220124) has the molecular formula C16H16F3N3O4 and a molecular weight of 371.32 g/mol. Its IUPAC name is (2R)-3-phenyl-2-[[2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]methoxyamino]propanoic acid.
| Compound Name | (2R)-3-phenyl-2-[[2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]methoxyamino]propanoic acid |
|---|---|
| PubChem CID | 161220124 |
| Molecular Formula | C16H16F3N3O4 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | (2R)-3-phenyl-2-[[2-(2,2,2-trifluoroethoxy)pyrimidin-4-yl]methoxyamino]propanoic acid |
| SMILES | O=C(O)[C@@H](Cc1ccccc1)NOCc1ccnc(OCC(F)(F)F)n1 |
| InChI | InChI=1S/C16H16F3N3O4/c17-16(18,19)10-25-15-20-7-6-12(21-15)9-26-22-13(14(23)24)8-11-4-2-1-3-5-11/h1-7,13,22H,8-10H2,(H,23,24)/t13-/m1/s1 |
| InChIKey | UXJVQEHNWRTBHY-CYBMUJFWSA-N |
| XLogP | 2.13 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|