C28H22BCl3N2O4 — CID 161220400
4-(3-chloro-5-ethenyl-2-pyridinyl)benzaldehyde;2,3-dichloro-5-ethenylpyridine;(4-formylphenyl)boronic acid (PubChem CID 161220400) has the molecular formula C28H22BCl3N2O4 and a molecular weight of 567.67 g/mol. Its IUPAC name is 4-(3-chloro-5-ethenyl-2-pyridinyl)benzaldehyde;2,3-dichloro-5-ethenylpyridine;(4-formylphenyl)boronic acid.
| Compound Name | 4-(3-chloro-5-ethenyl-2-pyridinyl)benzaldehyde;2,3-dichloro-5-ethenylpyridine;(4-formylphenyl)boronic acid |
|---|---|
| PubChem CID | 161220400 |
| Molecular Formula | C28H22BCl3N2O4 |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 566.07 |
| IUPAC Name | 4-(3-chloro-5-ethenyl-2-pyridinyl)benzaldehyde;2,3-dichloro-5-ethenylpyridine;(4-formylphenyl)boronic acid |
| SMILES | C=Cc1cnc(-c2ccc(C=O)cc2)c(Cl)c1.C=Cc1cnc(Cl)c(Cl)c1.O=Cc1ccc(B(O)O)cc1 |
| InChI | InChI=1S/C14H10ClNO.C7H7BO3.C7H5Cl2N/c1-2-10-7-13(15)14(16-8-10)12-5-3-11(9-17)4-6-12;9-5-6-1-3-7(4-2-6)8(10)11;1-2-5-3-6(8)7(9)10-4-5/h2-9H,1H2;1-5,10-11H;2-4H,1H2 |
| InChIKey | UXKRFVFLYQKAPM-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|