About (2-ethoxy-7-methylphenothiazin-3-ylidene)azanium;oxido sulfite
(2-ethoxy-7-methylphenothiazin-3-ylidene)azanium;oxido sulfite (PubChem CID 161221100) has the molecular formula C15H15N2O5S2-
and a molecular weight of 367.43 g/mol. Its IUPAC name is (2-ethoxy-7-methylphenothiazin-3-ylidene)azanium;oxido sulfite.
Molecular Properties
| Compound Name | (2-ethoxy-7-methylphenothiazin-3-ylidene)azanium;oxido sulfite |
| PubChem CID | 161221100 |
| Molecular Formula | C15H15N2O5S2- |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | (2-ethoxy-7-methylphenothiazin-3-ylidene)azanium;oxido sulfite |
| SMILES | CCOc1cc2nc3ccc(C)cc3sc-2cc1=[NH2+].O=S([O-])O[O-] |
| InChI | InChI=1S/C15H14N2OS.H2O4S/c1-3-18-13-8-12-15(7-10(13)16)19-14-6-9(2)4-5-11(14)17-12;1-4-5(2)3/h4-8,16H,3H2,1-2H3;1H,(H,2,3)/p-1 |
| InChIKey | NTIZNPLPMHHABT-UHFFFAOYSA-M |
| XLogP | -0.16 |
| TPSA | 120.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze (2-ethoxy-7-methylphenothiazin-3-ylidene)azanium;oxido sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethoxy-7-methylphenothiazin-3-ylidene)azanium;oxido sulfite?
The IUPAC name of (2-ethoxy-7-methylphenothiazin-3-ylidene)azanium;oxido sulfite (CID 161221100) is (2-ethoxy-7-methylphenothiazin-3-ylidene)azanium;oxido sulfite.
What is the SMILES notation for (2-ethoxy-7-methylphenothiazin-3-ylidene)azanium;oxido sulfite?
The canonical SMILES for (2-ethoxy-7-methylphenothiazin-3-ylidene)azanium;oxido sulfite is CCOc1cc2nc3ccc(C)cc3sc-2cc1=[NH2+].O=S([O-])O[O-].
What is the InChIKey of (2-ethoxy-7-methylphenothiazin-3-ylidene)azanium;oxido sulfite?
The InChIKey is NTIZNPLPMHHABT-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H14N2OS.H2O4S/c1-3-18-13-8-12-15(7-10(13)16)19-14-6-9(2)4-5-11(14)17-12;1-4-5(2)3/h4-8,16H,3H2,1-2H3;1H,(H,2,3)/p-1.
What are the key properties of (2-ethoxy-7-methylphenothiazin-3-ylidene)azanium;oxido sulfite?
(2-ethoxy-7-methylphenothiazin-3-ylidene)azanium;oxido sulfite has a molecular weight of 367.43 g/mol, XLogP of -0.16, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethoxy-7-methylphenothiazin-3-ylidene)azanium;oxido sulfite is sourced from PubChem (CID 161221100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).