About methoxyethane;N-(2-propan-2-ylphenyl)acetamide
methoxyethane;N-(2-propan-2-ylphenyl)acetamide (PubChem CID 161222349) has the molecular formula C14H23NO2
and a molecular weight of 237.34 g/mol. Its IUPAC name is methoxyethane;N-(2-propan-2-ylphenyl)acetamide.
Molecular Properties
| Compound Name | methoxyethane;N-(2-propan-2-ylphenyl)acetamide |
| PubChem CID | 161222349 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | methoxyethane;N-(2-propan-2-ylphenyl)acetamide |
| SMILES | CC(=O)Nc1ccccc1C(C)C.CCOC |
| InChI | InChI=1S/C11H15NO.C3H8O/c1-8(2)10-6-4-5-7-11(10)12-9(3)13;1-3-4-2/h4-8H,1-3H3,(H,12,13);3H2,1-2H3 |
| InChIKey | UXRKJPKAOLRJLW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methoxyethane;N-(2-propan-2-ylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxyethane;N-(2-propan-2-ylphenyl)acetamide?
The IUPAC name of methoxyethane;N-(2-propan-2-ylphenyl)acetamide (CID 161222349) is methoxyethane;N-(2-propan-2-ylphenyl)acetamide.
What is the SMILES notation for methoxyethane;N-(2-propan-2-ylphenyl)acetamide?
The canonical SMILES for methoxyethane;N-(2-propan-2-ylphenyl)acetamide is CC(=O)Nc1ccccc1C(C)C.CCOC.
What is the InChIKey of methoxyethane;N-(2-propan-2-ylphenyl)acetamide?
The InChIKey is UXRKJPKAOLRJLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO.C3H8O/c1-8(2)10-6-4-5-7-11(10)12-9(3)13;1-3-4-2/h4-8H,1-3H3,(H,12,13);3H2,1-2H3.
What are the key properties of methoxyethane;N-(2-propan-2-ylphenyl)acetamide?
methoxyethane;N-(2-propan-2-ylphenyl)acetamide has a molecular weight of 237.34 g/mol, XLogP of 3.42, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methoxyethane;N-(2-propan-2-ylphenyl)acetamide is sourced from PubChem (CID 161222349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).