About 4-(2-bromo-4H-thieno[3,2-c][1]benzoxepin-10-ylidene)-1-methylpiperidine;hydrobromide
4-(2-bromo-4H-thieno[3,2-c][1]benzoxepin-10-ylidene)-1-methylpiperidine;hydrobromide (PubChem CID 161222996) has the molecular formula C18H19Br2NOS
and a molecular weight of 457.23 g/mol. Its IUPAC name is 4-(2-bromo-4H-thieno[3,2-c][1]benzoxepin-10-ylidene)-1-methylpiperidine;hydrobromide.
Molecular Properties
| Compound Name | 4-(2-bromo-4H-thieno[3,2-c][1]benzoxepin-10-ylidene)-1-methylpiperidine;hydrobromide |
| PubChem CID | 161222996 |
| Molecular Formula | C18H19Br2NOS |
| Molecular Weight | 457.23 g/mol |
| Exact Mass | 454.96 |
| IUPAC Name | 4-(2-bromo-4H-thieno[3,2-c][1]benzoxepin-10-ylidene)-1-methylpiperidine;hydrobromide |
| SMILES | Br.CN1CCC(=C2c3ccccc3OCc3cc(Br)sc32)CC1 |
| InChI | InChI=1S/C18H18BrNOS.BrH/c1-20-8-6-12(7-9-20)17-14-4-2-3-5-15(14)21-11-13-10-16(19)22-18(13)17;/h2-5,10H,6-9,11H2,1H3;1H |
| InChIKey | RCEWLPONZJHFNM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.23 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2-bromo-4H-thieno[3,2-c][1]benzoxepin-10-ylidene)-1-methylpiperidine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromo-4H-thieno[3,2-c][1]benzoxepin-10-ylidene)-1-methylpiperidine;hydrobromide?
The IUPAC name of 4-(2-bromo-4H-thieno[3,2-c][1]benzoxepin-10-ylidene)-1-methylpiperidine;hydrobromide (CID 161222996) is 4-(2-bromo-4H-thieno[3,2-c][1]benzoxepin-10-ylidene)-1-methylpiperidine;hydrobromide.
What is the SMILES notation for 4-(2-bromo-4H-thieno[3,2-c][1]benzoxepin-10-ylidene)-1-methylpiperidine;hydrobromide?
The canonical SMILES for 4-(2-bromo-4H-thieno[3,2-c][1]benzoxepin-10-ylidene)-1-methylpiperidine;hydrobromide is Br.CN1CCC(=C2c3ccccc3OCc3cc(Br)sc32)CC1.
What is the InChIKey of 4-(2-bromo-4H-thieno[3,2-c][1]benzoxepin-10-ylidene)-1-methylpiperidine;hydrobromide?
The InChIKey is RCEWLPONZJHFNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18BrNOS.BrH/c1-20-8-6-12(7-9-20)17-14-4-2-3-5-15(14)21-11-13-10-16(19)22-18(13)17;/h2-5,10H,6-9,11H2,1H3;1H.
What are the key properties of 4-(2-bromo-4H-thieno[3,2-c][1]benzoxepin-10-ylidene)-1-methylpiperidine;hydrobromide?
4-(2-bromo-4H-thieno[3,2-c][1]benzoxepin-10-ylidene)-1-methylpiperidine;hydrobromide has a molecular weight of 457.23 g/mol, XLogP of 5.51, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromo-4H-thieno[3,2-c][1]benzoxepin-10-ylidene)-1-methylpiperidine;hydrobromide is sourced from PubChem (CID 161222996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).