About 5-(2-chlorophenyl)pyrimidin-2-amine;methyl formate
5-(2-chlorophenyl)pyrimidin-2-amine;methyl formate (PubChem CID 161223968) has the molecular formula C12H12ClN3O2
and a molecular weight of 265.70 g/mol. Its IUPAC name is 5-(2-chlorophenyl)pyrimidin-2-amine;methyl formate.
Molecular Properties
| Compound Name | 5-(2-chlorophenyl)pyrimidin-2-amine;methyl formate |
| PubChem CID | 161223968 |
| Molecular Formula | C12H12ClN3O2 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 5-(2-chlorophenyl)pyrimidin-2-amine;methyl formate |
| SMILES | COC=O.Nc1ncc(-c2ccccc2Cl)cn1 |
| InChI | InChI=1S/C10H8ClN3.C2H4O2/c11-9-4-2-1-3-8(9)7-5-13-10(12)14-6-7;1-4-2-3/h1-6H,(H2,12,13,14);2H,1H3 |
| InChIKey | UXWNYMQBVGWAIB-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-chlorophenyl)pyrimidin-2-amine;methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-chlorophenyl)pyrimidin-2-amine;methyl formate?
The IUPAC name of 5-(2-chlorophenyl)pyrimidin-2-amine;methyl formate (CID 161223968) is 5-(2-chlorophenyl)pyrimidin-2-amine;methyl formate.
What is the SMILES notation for 5-(2-chlorophenyl)pyrimidin-2-amine;methyl formate?
The canonical SMILES for 5-(2-chlorophenyl)pyrimidin-2-amine;methyl formate is COC=O.Nc1ncc(-c2ccccc2Cl)cn1.
What is the InChIKey of 5-(2-chlorophenyl)pyrimidin-2-amine;methyl formate?
The InChIKey is UXWNYMQBVGWAIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClN3.C2H4O2/c11-9-4-2-1-3-8(9)7-5-13-10(12)14-6-7;1-4-2-3/h1-6H,(H2,12,13,14);2H,1H3.
What are the key properties of 5-(2-chlorophenyl)pyrimidin-2-amine;methyl formate?
5-(2-chlorophenyl)pyrimidin-2-amine;methyl formate has a molecular weight of 265.70 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-chlorophenyl)pyrimidin-2-amine;methyl formate is sourced from PubChem (CID 161223968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).