C19H23I2N — CID 161224076
molecular iodine;6,12,13,14,15-pentamethyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene (PubChem CID 161224076) has the molecular formula C19H23I2N and a molecular weight of 519.21 g/mol. Its IUPAC name is molecular iodine;6,12,13,14,15-pentamethyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene.
| Compound Name | molecular iodine;6,12,13,14,15-pentamethyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene |
|---|---|
| PubChem CID | 161224076 |
| Molecular Formula | C19H23I2N |
| Molecular Weight | 519.21 g/mol |
| Exact Mass | 518.99 |
| IUPAC Name | molecular iodine;6,12,13,14,15-pentamethyl-4-azatricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaene |
| SMILES | Cc1cnc2c(c1)CCc1c(C)c(C)c(C)c(C)c1C2.II |
| InChI | InChI=1S/C19H23N.I2/c1-11-8-16-6-7-17-14(4)12(2)13(3)15(5)18(17)9-19(16)20-10-11;1-2/h8,10H,6-7,9H2,1-5H3; |
| InChIKey | UXWVQWGZDPUFQR-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.21 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|