About 4-chlorobenzoate;tris(2-methyl-2-phenylpropyl)stannanylium
4-chlorobenzoate;tris(2-methyl-2-phenylpropyl)stannanylium (PubChem CID 161224128) has the molecular formula C37H43ClO2Sn
and a molecular weight of 673.91 g/mol. Its IUPAC name is 4-chlorobenzoate;tris(2-methyl-2-phenylpropyl)stannanylium.
Molecular Properties
| Compound Name | 4-chlorobenzoate;tris(2-methyl-2-phenylpropyl)stannanylium |
| PubChem CID | 161224128 |
| Molecular Formula | C37H43ClO2Sn |
| Molecular Weight | 673.91 g/mol |
| Exact Mass | 674.20 |
| IUPAC Name | 4-chlorobenzoate;tris(2-methyl-2-phenylpropyl)stannanylium |
| SMILES | CC(C)(C[Sn+](CC(C)(C)c1ccccc1)CC(C)(C)c1ccccc1)c1ccccc1.O=C([O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/3C10H13.C7H5ClO2.Sn/c3*1-10(2,3)9-7-5-4-6-8-9;8-6-3-1-5(2-4-6)7(9)10;/h3*4-8H,1H2,2-3H3;1-4H,(H,9,10);/q;;;;+1/p-1 |
| InChIKey | UXWZQYHXOQWRSH-UHFFFAOYSA-M |
| XLogP | 9.12 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 673.91 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-chlorobenzoate;tris(2-methyl-2-phenylpropyl)stannanylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chlorobenzoate;tris(2-methyl-2-phenylpropyl)stannanylium?
The IUPAC name of 4-chlorobenzoate;tris(2-methyl-2-phenylpropyl)stannanylium (CID 161224128) is 4-chlorobenzoate;tris(2-methyl-2-phenylpropyl)stannanylium.
What is the SMILES notation for 4-chlorobenzoate;tris(2-methyl-2-phenylpropyl)stannanylium?
The canonical SMILES for 4-chlorobenzoate;tris(2-methyl-2-phenylpropyl)stannanylium is CC(C)(C[Sn+](CC(C)(C)c1ccccc1)CC(C)(C)c1ccccc1)c1ccccc1.O=C([O-])c1ccc(Cl)cc1.
What is the InChIKey of 4-chlorobenzoate;tris(2-methyl-2-phenylpropyl)stannanylium?
The InChIKey is UXWZQYHXOQWRSH-UHFFFAOYSA-M. The full InChI is InChI=1S/3C10H13.C7H5ClO2.Sn/c3*1-10(2,3)9-7-5-4-6-8-9;8-6-3-1-5(2-4-6)7(9)10;/h3*4-8H,1H2,2-3H3;1-4H,(H,9,10);/q;;;;+1/p-1.
What are the key properties of 4-chlorobenzoate;tris(2-methyl-2-phenylpropyl)stannanylium?
4-chlorobenzoate;tris(2-methyl-2-phenylpropyl)stannanylium has a molecular weight of 673.91 g/mol, XLogP of 9.12, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chlorobenzoate;tris(2-methyl-2-phenylpropyl)stannanylium is sourced from PubChem (CID 161224128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).