C44H74F6N8O4 — CID 161224755
N'-[[3-[4-ethyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexyl]-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-yl]methyl]-N,N'-dimethylethane-1,2-diamine (PubChem CID 161224755) has the molecular formula C44H74F6N8O4 and a molecular weight of 893.12 g/mol. Its IUPAC name is N'-[[3-[4-ethyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexyl]-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-yl]methyl]-N,N'-dimethylethane-1,2-diamine.
| Compound Name | N'-[[3-[4-ethyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexyl]-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-yl]methyl]-N,N'-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 161224755 |
| Molecular Formula | C44H74F6N8O4 |
| Molecular Weight | 893.12 g/mol |
| Exact Mass | 892.57 |
| IUPAC Name | N'-[[3-[4-ethyl-4-(2,2,2-trifluoroethoxymethyl)cyclohexyl]-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazin-2-yl]methyl]-N,N'-dimethylethane-1,2-diamine |
| SMILES | CCC1(COCC(F)(F)F)CCC(c2c(CN(C)CCNC)nn3c2COCC3)CC1.CCC1(COCC(F)(F)F)CCC(c2c(CN(C)CCNC)nn3c2COCC3)CC1 |
| InChI | InChI=1S/2C22H37F3N4O2/c2*1-4-21(15-31-16-22(23,24)25)7-5-17(6-8-21)20-18(13-28(3)10-9-26-2)27-29-11-12-30-14-19(20)29/h2*17,26H,4-16H2,1-3H3 |
| InChIKey | UXYWHWNHRLEZFW-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 103.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 893.12 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |