About 1-(5-phenyl-1,2-oxazol-3-yl)-7-pyrrolidin-1-ylheptane-1,7-dione
1-(5-phenyl-1,2-oxazol-3-yl)-7-pyrrolidin-1-ylheptane-1,7-dione (PubChem CID 161225854) has the molecular formula C20H24N2O3
and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-(5-phenyl-1,2-oxazol-3-yl)-7-pyrrolidin-1-ylheptane-1,7-dione.
Molecular Properties
| Compound Name | 1-(5-phenyl-1,2-oxazol-3-yl)-7-pyrrolidin-1-ylheptane-1,7-dione |
| PubChem CID | 161225854 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-(5-phenyl-1,2-oxazol-3-yl)-7-pyrrolidin-1-ylheptane-1,7-dione |
| SMILES | O=C(CCCCCC(=O)N1CCCC1)c1cc(-c2ccccc2)on1 |
| InChI | InChI=1S/C20H24N2O3/c23-18(11-5-2-6-12-20(24)22-13-7-8-14-22)17-15-19(25-21-17)16-9-3-1-4-10-16/h1,3-4,9-10,15H,2,5-8,11-14H2 |
| InChIKey | UYCNHDJNRRLTCT-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-phenyl-1,2-oxazol-3-yl)-7-pyrrolidin-1-ylheptane-1,7-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-phenyl-1,2-oxazol-3-yl)-7-pyrrolidin-1-ylheptane-1,7-dione?
The IUPAC name of 1-(5-phenyl-1,2-oxazol-3-yl)-7-pyrrolidin-1-ylheptane-1,7-dione (CID 161225854) is 1-(5-phenyl-1,2-oxazol-3-yl)-7-pyrrolidin-1-ylheptane-1,7-dione.
What is the SMILES notation for 1-(5-phenyl-1,2-oxazol-3-yl)-7-pyrrolidin-1-ylheptane-1,7-dione?
The canonical SMILES for 1-(5-phenyl-1,2-oxazol-3-yl)-7-pyrrolidin-1-ylheptane-1,7-dione is O=C(CCCCCC(=O)N1CCCC1)c1cc(-c2ccccc2)on1.
What is the InChIKey of 1-(5-phenyl-1,2-oxazol-3-yl)-7-pyrrolidin-1-ylheptane-1,7-dione?
The InChIKey is UYCNHDJNRRLTCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O3/c23-18(11-5-2-6-12-20(24)22-13-7-8-14-22)17-15-19(25-21-17)16-9-3-1-4-10-16/h1,3-4,9-10,15H,2,5-8,11-14H2.
What are the key properties of 1-(5-phenyl-1,2-oxazol-3-yl)-7-pyrrolidin-1-ylheptane-1,7-dione?
1-(5-phenyl-1,2-oxazol-3-yl)-7-pyrrolidin-1-ylheptane-1,7-dione has a molecular weight of 340.42 g/mol, XLogP of 4.10, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-phenyl-1,2-oxazol-3-yl)-7-pyrrolidin-1-ylheptane-1,7-dione is sourced from PubChem (CID 161225854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).