About N-amino-N'-methylpropanimidamide;hydrochloride
N-amino-N'-methylpropanimidamide;hydrochloride (PubChem CID 161226126) has the molecular formula C4H12ClN3
and a molecular weight of 137.61 g/mol. Its IUPAC name is N-amino-N'-methylpropanimidamide;hydrochloride.
Molecular Properties
| Compound Name | N-amino-N'-methylpropanimidamide;hydrochloride |
| PubChem CID | 161226126 |
| Molecular Formula | C4H12ClN3 |
| Molecular Weight | 137.61 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | N-amino-N'-methylpropanimidamide;hydrochloride |
| SMILES | CC/C(=N\C)NN.Cl |
| InChI | InChI=1S/C4H11N3.ClH/c1-3-4(6-2)7-5;/h3,5H2,1-2H3,(H,6,7);1H |
| InChIKey | UYDMGZMKUMYVNV-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.61 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-N'-methylpropanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-N'-methylpropanimidamide;hydrochloride?
The IUPAC name of N-amino-N'-methylpropanimidamide;hydrochloride (CID 161226126) is N-amino-N'-methylpropanimidamide;hydrochloride.
What is the SMILES notation for N-amino-N'-methylpropanimidamide;hydrochloride?
The canonical SMILES for N-amino-N'-methylpropanimidamide;hydrochloride is CC/C(=N\C)NN.Cl.
What is the InChIKey of N-amino-N'-methylpropanimidamide;hydrochloride?
The InChIKey is UYDMGZMKUMYVNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H11N3.ClH/c1-3-4(6-2)7-5;/h3,5H2,1-2H3,(H,6,7);1H.
What are the key properties of N-amino-N'-methylpropanimidamide;hydrochloride?
N-amino-N'-methylpropanimidamide;hydrochloride has a molecular weight of 137.61 g/mol, XLogP of 0.31, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-N'-methylpropanimidamide;hydrochloride is sourced from PubChem (CID 161226126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).