About aniline;1-benzyl-2,3-dichlorobenzene;1-bromo-2,3-dichlorobenzene
aniline;1-benzyl-2,3-dichlorobenzene;1-bromo-2,3-dichlorobenzene (PubChem CID 161226216) has the molecular formula C25H20BrCl4N
and a molecular weight of 556.16 g/mol. Its IUPAC name is aniline;1-benzyl-2,3-dichlorobenzene;1-bromo-2,3-dichlorobenzene.
Molecular Properties
| Compound Name | aniline;1-benzyl-2,3-dichlorobenzene;1-bromo-2,3-dichlorobenzene |
| PubChem CID | 161226216 |
| Molecular Formula | C25H20BrCl4N |
| Molecular Weight | 556.16 g/mol |
| Exact Mass | 552.95 |
| IUPAC Name | aniline;1-benzyl-2,3-dichlorobenzene;1-bromo-2,3-dichlorobenzene |
| SMILES | Clc1cccc(Br)c1Cl.Clc1cccc(Cc2ccccc2)c1Cl.Nc1ccccc1 |
| InChI | InChI=1S/C13H10Cl2.C6H3BrCl2.C6H7N/c14-12-8-4-7-11(13(12)15)9-10-5-2-1-3-6-10;7-4-2-1-3-5(8)6(4)9;7-6-4-2-1-3-5-6/h1-8H,9H2;1-3H;1-5H,7H2 |
| InChIKey | UYDUNGNSNLODRE-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.16 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze aniline;1-benzyl-2,3-dichlorobenzene;1-bromo-2,3-dichlorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;1-benzyl-2,3-dichlorobenzene;1-bromo-2,3-dichlorobenzene?
The IUPAC name of aniline;1-benzyl-2,3-dichlorobenzene;1-bromo-2,3-dichlorobenzene (CID 161226216) is aniline;1-benzyl-2,3-dichlorobenzene;1-bromo-2,3-dichlorobenzene.
What is the SMILES notation for aniline;1-benzyl-2,3-dichlorobenzene;1-bromo-2,3-dichlorobenzene?
The canonical SMILES for aniline;1-benzyl-2,3-dichlorobenzene;1-bromo-2,3-dichlorobenzene is Clc1cccc(Br)c1Cl.Clc1cccc(Cc2ccccc2)c1Cl.Nc1ccccc1.
What is the InChIKey of aniline;1-benzyl-2,3-dichlorobenzene;1-bromo-2,3-dichlorobenzene?
The InChIKey is UYDUNGNSNLODRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10Cl2.C6H3BrCl2.C6H7N/c14-12-8-4-7-11(13(12)15)9-10-5-2-1-3-6-10;7-4-2-1-3-5(8)6(4)9;7-6-4-2-1-3-5-6/h1-8H,9H2;1-3H;1-5H,7H2.
What are the key properties of aniline;1-benzyl-2,3-dichlorobenzene;1-bromo-2,3-dichlorobenzene?
aniline;1-benzyl-2,3-dichlorobenzene;1-bromo-2,3-dichlorobenzene has a molecular weight of 556.16 g/mol, XLogP of 9.61, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;1-benzyl-2,3-dichlorobenzene;1-bromo-2,3-dichlorobenzene is sourced from PubChem (CID 161226216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).