C24H36FNO5S — CID 161227719
3-[5-[(2R)-2-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]propyl]sulfonylpentyl]piperidine-2,6-dione (PubChem CID 161227719) has the molecular formula C24H36FNO5S and a molecular weight of 469.62 g/mol. Its IUPAC name is 3-[5-[(2R)-2-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]propyl]sulfonylpentyl]piperidine-2,6-dione.
| Compound Name | 3-[5-[(2R)-2-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]propyl]sulfonylpentyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 161227719 |
| Molecular Formula | C24H36FNO5S |
| Molecular Weight | 469.62 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 3-[5-[(2R)-2-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]propyl]sulfonylpentyl]piperidine-2,6-dione |
| SMILES | C[C@@H](CS(=O)(=O)CCCCCC1CCC(=O)NC1=O)c1ccc(F)c(OCC(C)(C)C)c1 |
| InChI | InChI=1S/C24H36FNO5S/c1-17(19-9-11-20(25)21(14-19)31-16-24(2,3)4)15-32(29,30)13-7-5-6-8-18-10-12-22(27)26-23(18)28/h9,11,14,17-18H,5-8,10,12-13,15-16H2,1-4H3,(H,26,27,28)/t17-,18?/m0/s1 |
| InChIKey | UYIOSCMJBXOWGO-ZENAZSQFSA-N |
| XLogP | 4.38 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.62 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|