About 4-trichlorosilylbutanenitrile;4-trifluorosilylbutanenitrile;hydrate
4-trichlorosilylbutanenitrile;4-trifluorosilylbutanenitrile;hydrate (PubChem CID 161228348) has the molecular formula C8H14Cl3F3N2OSi2
and a molecular weight of 373.74 g/mol. Its IUPAC name is 4-trichlorosilylbutanenitrile;4-trifluorosilylbutanenitrile;hydrate.
Molecular Properties
| Compound Name | 4-trichlorosilylbutanenitrile;4-trifluorosilylbutanenitrile;hydrate |
| PubChem CID | 161228348 |
| Molecular Formula | C8H14Cl3F3N2OSi2 |
| Molecular Weight | 373.74 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 4-trichlorosilylbutanenitrile;4-trifluorosilylbutanenitrile;hydrate |
| SMILES | N#CCCC[Si](Cl)(Cl)Cl.N#CCCC[Si](F)(F)F.O |
| InChI | InChI=1S/C4H6Cl3NSi.C4H6F3NSi.H2O/c2*5-9(6,7)4-2-1-3-8;/h2*1-2,4H2;1H2 |
| InChIKey | WJIQKLQBQHVTEW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 79.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.74 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 4-trichlorosilylbutanenitrile;4-trifluorosilylbutanenitrile;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-trichlorosilylbutanenitrile;4-trifluorosilylbutanenitrile;hydrate?
The IUPAC name of 4-trichlorosilylbutanenitrile;4-trifluorosilylbutanenitrile;hydrate (CID 161228348) is 4-trichlorosilylbutanenitrile;4-trifluorosilylbutanenitrile;hydrate.
What is the SMILES notation for 4-trichlorosilylbutanenitrile;4-trifluorosilylbutanenitrile;hydrate?
The canonical SMILES for 4-trichlorosilylbutanenitrile;4-trifluorosilylbutanenitrile;hydrate is N#CCCC[Si](Cl)(Cl)Cl.N#CCCC[Si](F)(F)F.O.
What is the InChIKey of 4-trichlorosilylbutanenitrile;4-trifluorosilylbutanenitrile;hydrate?
The InChIKey is WJIQKLQBQHVTEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6Cl3NSi.C4H6F3NSi.H2O/c2*5-9(6,7)4-2-1-3-8;/h2*1-2,4H2;1H2.
What are the key properties of 4-trichlorosilylbutanenitrile;4-trifluorosilylbutanenitrile;hydrate?
4-trichlorosilylbutanenitrile;4-trifluorosilylbutanenitrile;hydrate has a molecular weight of 373.74 g/mol, XLogP of 4.26, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-trichlorosilylbutanenitrile;4-trifluorosilylbutanenitrile;hydrate is sourced from PubChem (CID 161228348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).