About 6-methyl-4-propan-2-ylpyridin-2-amine;4-propan-2-yl-6-(trifluoromethyl)pyridin-2-amine
6-methyl-4-propan-2-ylpyridin-2-amine;4-propan-2-yl-6-(trifluoromethyl)pyridin-2-amine (PubChem CID 161228636) has the molecular formula C18H25F3N4
and a molecular weight of 354.42 g/mol. Its IUPAC name is 6-methyl-4-propan-2-ylpyridin-2-amine;4-propan-2-yl-6-(trifluoromethyl)pyridin-2-amine.
Molecular Properties
| Compound Name | 6-methyl-4-propan-2-ylpyridin-2-amine;4-propan-2-yl-6-(trifluoromethyl)pyridin-2-amine |
| PubChem CID | 161228636 |
| Molecular Formula | C18H25F3N4 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 6-methyl-4-propan-2-ylpyridin-2-amine;4-propan-2-yl-6-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(C)c1cc(N)nc(C(F)(F)F)c1.Cc1cc(C(C)C)cc(N)n1 |
| InChI | InChI=1S/C9H11F3N2.C9H14N2/c1-5(2)6-3-7(9(10,11)12)14-8(13)4-6;1-6(2)8-4-7(3)11-9(10)5-8/h3-5H,1-2H3,(H2,13,14);4-6H,1-3H3,(H2,10,11) |
| InChIKey | UYLNGADHLGWALS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-methyl-4-propan-2-ylpyridin-2-amine;4-propan-2-yl-6-(trifluoromethyl)pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4-propan-2-ylpyridin-2-amine;4-propan-2-yl-6-(trifluoromethyl)pyridin-2-amine?
The IUPAC name of 6-methyl-4-propan-2-ylpyridin-2-amine;4-propan-2-yl-6-(trifluoromethyl)pyridin-2-amine (CID 161228636) is 6-methyl-4-propan-2-ylpyridin-2-amine;4-propan-2-yl-6-(trifluoromethyl)pyridin-2-amine.
What is the SMILES notation for 6-methyl-4-propan-2-ylpyridin-2-amine;4-propan-2-yl-6-(trifluoromethyl)pyridin-2-amine?
The canonical SMILES for 6-methyl-4-propan-2-ylpyridin-2-amine;4-propan-2-yl-6-(trifluoromethyl)pyridin-2-amine is CC(C)c1cc(N)nc(C(F)(F)F)c1.Cc1cc(C(C)C)cc(N)n1.
What is the InChIKey of 6-methyl-4-propan-2-ylpyridin-2-amine;4-propan-2-yl-6-(trifluoromethyl)pyridin-2-amine?
The InChIKey is UYLNGADHLGWALS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11F3N2.C9H14N2/c1-5(2)6-3-7(9(10,11)12)14-8(13)4-6;1-6(2)8-4-7(3)11-9(10)5-8/h3-5H,1-2H3,(H2,13,14);4-6H,1-3H3,(H2,10,11).
What are the key properties of 6-methyl-4-propan-2-ylpyridin-2-amine;4-propan-2-yl-6-(trifluoromethyl)pyridin-2-amine?
6-methyl-4-propan-2-ylpyridin-2-amine;4-propan-2-yl-6-(trifluoromethyl)pyridin-2-amine has a molecular weight of 354.42 g/mol, XLogP of 4.90, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4-propan-2-ylpyridin-2-amine;4-propan-2-yl-6-(trifluoromethyl)pyridin-2-amine is sourced from PubChem (CID 161228636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).