About but-3-en-2-one;(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;hydrate
but-3-en-2-one;(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;hydrate (PubChem CID 161229491) has the molecular formula C11H15NO6
and a molecular weight of 257.24 g/mol. Its IUPAC name is but-3-en-2-one;(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;hydrate.
Molecular Properties
| Compound Name | but-3-en-2-one;(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;hydrate |
| PubChem CID | 161229491 |
| Molecular Formula | C11H15NO6 |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | but-3-en-2-one;(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;hydrate |
| SMILES | C=CC(=O)ON1C(=O)CCC1=O.C=CC(C)=O.O |
| InChI | InChI=1S/C7H7NO4.C4H6O.H2O/c1-2-7(11)12-8-5(9)3-4-6(8)10;1-3-4(2)5;/h2H,1,3-4H2;3H,1H2,2H3;1H2 |
| InChIKey | PRBFWFANTMGZPC-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 112.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-one;(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-one;(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;hydrate?
The IUPAC name of but-3-en-2-one;(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;hydrate (CID 161229491) is but-3-en-2-one;(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;hydrate.
What is the SMILES notation for but-3-en-2-one;(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;hydrate?
The canonical SMILES for but-3-en-2-one;(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;hydrate is C=CC(=O)ON1C(=O)CCC1=O.C=CC(C)=O.O.
What is the InChIKey of but-3-en-2-one;(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;hydrate?
The InChIKey is PRBFWFANTMGZPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4.C4H6O.H2O/c1-2-7(11)12-8-5(9)3-4-6(8)10;1-3-4(2)5;/h2H,1,3-4H2;3H,1H2,2H3;1H2.
What are the key properties of but-3-en-2-one;(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;hydrate?
but-3-en-2-one;(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;hydrate has a molecular weight of 257.24 g/mol, XLogP of -0.28, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-one;(2,5-dioxopyrrolidin-1-yl) prop-2-enoate;hydrate is sourced from PubChem (CID 161229491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).