About CID 161230503
CID 161230503 (PubChem CID 161230503) has the molecular formula C16H10BN2O2
and a molecular weight of 273.08 g/mol.
Molecular Properties
| Compound Name | CID 161230503 |
| PubChem CID | 161230503 |
| Molecular Formula | C16H10BN2O2 |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | — |
| SMILES | O=C1C=c2ccccc2=N1.O=C1C=c2ccccc2=N1.[B] |
| InChI | InChI=1S/2C8H5NO.B/c2*10-8-5-6-3-1-2-4-7(6)9-8;/h2*1-5H; |
| InChIKey | UYRPDMDMVLMXCM-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 161230503 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 161230503?
The IUPAC name of CID 161230503 (CID 161230503) is not available.
What is the SMILES notation for CID 161230503?
The canonical SMILES for CID 161230503 is O=C1C=c2ccccc2=N1.O=C1C=c2ccccc2=N1.[B].
What is the InChIKey of CID 161230503?
The InChIKey is UYRPDMDMVLMXCM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H5NO.B/c2*10-8-5-6-3-1-2-4-7(6)9-8;/h2*1-5H;.
What are the key properties of CID 161230503?
CID 161230503 has a molecular weight of 273.08 g/mol, XLogP of -1.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 161230503 is sourced from PubChem (CID 161230503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).